2020-06-03 02:51:13 +03:00
|
|
|
/* This Source Code Form is subject to the terms of the Mozilla Public
|
|
|
|
* License, v. 2.0. If a copy of the MPL was not distributed with this
|
|
|
|
* file, You can obtain one at http://mozilla.org/MPL/2.0/. */
|
|
|
|
|
|
|
|
const {EventEmitter} = ChromeUtils.import('resource://gre/modules/EventEmitter.jsm');
|
|
|
|
const {Helper} = ChromeUtils.import('chrome://juggler/content/Helper.js');
|
|
|
|
const {SimpleChannel} = ChromeUtils.import('chrome://juggler/content/SimpleChannel.js');
|
|
|
|
const {Services} = ChromeUtils.import("resource://gre/modules/Services.jsm");
|
|
|
|
const {Preferences} = ChromeUtils.import("resource://gre/modules/Preferences.jsm");
|
|
|
|
const {ContextualIdentityService} = ChromeUtils.import("resource://gre/modules/ContextualIdentityService.jsm");
|
|
|
|
const {NetUtil} = ChromeUtils.import('resource://gre/modules/NetUtil.jsm');
|
|
|
|
const {AppConstants} = ChromeUtils.import("resource://gre/modules/AppConstants.jsm");
|
2020-10-03 03:16:49 +03:00
|
|
|
const {OS} = ChromeUtils.import("resource://gre/modules/osfile.jsm");
|
2020-06-03 02:51:13 +03:00
|
|
|
|
|
|
|
const helper = new Helper();
|
|
|
|
|
|
|
|
const IDENTITY_NAME = 'JUGGLER ';
|
|
|
|
const HUNDRED_YEARS = 60 * 60 * 24 * 365 * 100;
|
|
|
|
|
|
|
|
const ALL_PERMISSIONS = [
|
|
|
|
'geo',
|
|
|
|
'desktop-notification',
|
|
|
|
];
|
|
|
|
|
|
|
|
class DownloadInterceptor {
|
|
|
|
constructor(registry) {
|
|
|
|
this._registry = registry
|
|
|
|
this._handlerToUuid = new Map();
|
|
|
|
}
|
|
|
|
|
|
|
|
//
|
|
|
|
// nsIDownloadInterceptor implementation.
|
|
|
|
//
|
|
|
|
interceptDownloadRequest(externalAppHandler, request, browsingContext, outFile) {
|
2020-10-06 10:15:24 +03:00
|
|
|
if (!(request instanceof Ci.nsIChannel))
|
|
|
|
return false;
|
|
|
|
const channel = request.QueryInterface(Ci.nsIChannel);
|
|
|
|
let pageTarget = this._registry._browserBrowsingContextToTarget.get(channel.loadInfo.browsingContext);
|
2020-06-03 02:51:13 +03:00
|
|
|
if (!pageTarget)
|
|
|
|
return false;
|
|
|
|
|
|
|
|
const browserContext = pageTarget.browserContext();
|
|
|
|
const options = browserContext.downloadOptions;
|
|
|
|
if (!options)
|
|
|
|
return false;
|
|
|
|
|
|
|
|
const uuid = helper.generateId();
|
|
|
|
let file = null;
|
|
|
|
if (options.behavior === 'saveToDisk') {
|
|
|
|
file = Cc["@mozilla.org/file/local;1"].createInstance(Ci.nsIFile);
|
|
|
|
file.initWithPath(options.downloadsDir);
|
|
|
|
file.append(uuid);
|
|
|
|
|
|
|
|
try {
|
|
|
|
file.create(Ci.nsIFile.NORMAL_FILE_TYPE, 0o600);
|
|
|
|
} catch (e) {
|
|
|
|
dump(`interceptDownloadRequest failed to create file: ${e}\n`);
|
|
|
|
return false;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
outFile.value = file;
|
|
|
|
this._handlerToUuid.set(externalAppHandler, uuid);
|
|
|
|
const downloadInfo = {
|
|
|
|
uuid,
|
|
|
|
browserContextId: browserContext.browserContextId,
|
|
|
|
pageTargetId: pageTarget.id(),
|
|
|
|
url: request.name,
|
|
|
|
suggestedFileName: externalAppHandler.suggestedFileName,
|
|
|
|
};
|
|
|
|
this._registry.emit(TargetRegistry.Events.DownloadCreated, downloadInfo);
|
|
|
|
return true;
|
|
|
|
}
|
|
|
|
|
|
|
|
onDownloadComplete(externalAppHandler, canceled, errorName) {
|
|
|
|
const uuid = this._handlerToUuid.get(externalAppHandler);
|
|
|
|
if (!uuid)
|
|
|
|
return;
|
|
|
|
this._handlerToUuid.delete(externalAppHandler);
|
|
|
|
const downloadInfo = {
|
|
|
|
uuid,
|
|
|
|
};
|
|
|
|
if (errorName === 'NS_BINDING_ABORTED') {
|
|
|
|
downloadInfo.canceled = true;
|
|
|
|
} else {
|
|
|
|
downloadInfo.error = errorName;
|
|
|
|
}
|
|
|
|
this._registry.emit(TargetRegistry.Events.DownloadFinished, downloadInfo);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2021-05-08 04:05:26 +03:00
|
|
|
const screencastService = Cc['@mozilla.org/juggler/screencast;1'].getService(Ci.nsIScreencastService);
|
|
|
|
|
2020-06-03 02:51:13 +03:00
|
|
|
class TargetRegistry {
|
|
|
|
constructor() {
|
|
|
|
EventEmitter.decorate(this);
|
|
|
|
|
|
|
|
this._browserContextIdToBrowserContext = new Map();
|
|
|
|
this._userContextIdToBrowserContext = new Map();
|
|
|
|
this._browserToTarget = new Map();
|
|
|
|
this._browserBrowsingContextToTarget = new Map();
|
|
|
|
|
2020-08-08 01:38:06 +03:00
|
|
|
this._browserProxy = null;
|
|
|
|
|
2020-06-03 02:51:13 +03:00
|
|
|
// Cleanup containers from previous runs (if any)
|
|
|
|
for (const identity of ContextualIdentityService.getPublicIdentities()) {
|
|
|
|
if (identity.name && identity.name.startsWith(IDENTITY_NAME)) {
|
|
|
|
ContextualIdentityService.remove(identity.userContextId);
|
|
|
|
ContextualIdentityService.closeContainerTabs(identity.userContextId);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
this._defaultContext = new BrowserContext(this, undefined, undefined);
|
|
|
|
|
|
|
|
Services.obs.addObserver({
|
|
|
|
observe: (subject, topic, data) => {
|
|
|
|
const browser = subject.ownerElement;
|
|
|
|
if (!browser)
|
|
|
|
return;
|
|
|
|
const target = this._browserToTarget.get(browser);
|
|
|
|
if (!target)
|
|
|
|
return;
|
2020-10-06 11:53:25 +03:00
|
|
|
target.emit(PageTarget.Events.Crashed);
|
2020-08-26 00:50:40 +03:00
|
|
|
target.dispose();
|
2020-06-03 02:51:13 +03:00
|
|
|
}
|
|
|
|
}, 'oop-frameloader-crashed');
|
|
|
|
|
|
|
|
Services.mm.addMessageListener('juggler:content-ready', {
|
|
|
|
receiveMessage: message => {
|
|
|
|
const linkedBrowser = message.target;
|
2020-09-30 12:10:34 +03:00
|
|
|
const target = this._browserToTarget.get(linkedBrowser);
|
|
|
|
if (!target)
|
2020-06-03 02:51:13 +03:00
|
|
|
return;
|
|
|
|
|
|
|
|
return {
|
2020-09-30 12:10:34 +03:00
|
|
|
scriptsToEvaluateOnNewDocument: target.browserContext().scriptsToEvaluateOnNewDocument,
|
|
|
|
bindings: target.browserContext().bindings,
|
|
|
|
settings: target.browserContext().settings,
|
2020-06-03 02:51:13 +03:00
|
|
|
};
|
|
|
|
},
|
|
|
|
});
|
|
|
|
|
2020-09-30 10:36:46 +03:00
|
|
|
const onTabOpenListener = (appWindow, window, event) => {
|
2020-06-03 02:51:13 +03:00
|
|
|
const tab = event.target;
|
|
|
|
const userContextId = tab.userContextId;
|
|
|
|
const browserContext = this._userContextIdToBrowserContext.get(userContextId);
|
2020-10-02 14:13:42 +03:00
|
|
|
const hasExplicitSize = appWindow && (appWindow.chromeFlags & Ci.nsIWebBrowserChrome.JUGGLER_WINDOW_EXPLICIT_SIZE) !== 0;
|
2020-09-30 12:10:34 +03:00
|
|
|
const openerContext = tab.linkedBrowser.browsingContext.opener;
|
|
|
|
let openerTarget;
|
|
|
|
if (openerContext) {
|
|
|
|
// Popups usually have opener context.
|
|
|
|
openerTarget = this._browserBrowsingContextToTarget.get(openerContext);
|
|
|
|
} else if (tab.openerTab) {
|
|
|
|
// Noopener popups from the same window have opener tab instead.
|
|
|
|
openerTarget = this._browserToTarget.get(tab.openerTab.linkedBrowser);
|
|
|
|
}
|
|
|
|
if (!browserContext)
|
|
|
|
throw new Error(`Internal error: cannot find context for userContextId=${userContextId}`);
|
|
|
|
const target = new PageTarget(this, window, tab, browserContext, openerTarget);
|
2020-09-30 18:02:22 +03:00
|
|
|
target.updateUserAgent();
|
2020-11-18 19:19:09 +03:00
|
|
|
target.updateTouchOverride();
|
2021-03-03 05:52:19 +03:00
|
|
|
target.updateColorSchemeOverride();
|
2020-09-30 12:10:34 +03:00
|
|
|
if (!hasExplicitSize)
|
|
|
|
target.updateViewportSize();
|
2021-05-07 05:11:42 +03:00
|
|
|
if (browserContext.videoRecordingOptions)
|
|
|
|
target._startVideoRecording(browserContext.videoRecordingOptions);
|
2020-06-03 02:51:13 +03:00
|
|
|
};
|
|
|
|
|
2020-08-19 22:52:43 +03:00
|
|
|
const onTabCloseListener = event => {
|
2020-06-03 02:51:13 +03:00
|
|
|
const tab = event.target;
|
|
|
|
const linkedBrowser = tab.linkedBrowser;
|
|
|
|
const target = this._browserToTarget.get(linkedBrowser);
|
2020-08-20 23:26:04 +03:00
|
|
|
if (target)
|
2020-08-26 00:50:40 +03:00
|
|
|
target.dispose();
|
2020-06-03 02:51:13 +03:00
|
|
|
};
|
|
|
|
|
2020-09-30 10:36:46 +03:00
|
|
|
const domWindowTabListeners = new Map();
|
|
|
|
|
|
|
|
const onOpenWindow = async (appWindow) => {
|
2020-10-02 14:13:42 +03:00
|
|
|
|
|
|
|
let domWindow;
|
|
|
|
if (appWindow instanceof Ci.nsIAppWindow) {
|
|
|
|
domWindow = appWindow.QueryInterface(Ci.nsIInterfaceRequestor).getInterface(Ci.nsIDOMWindowInternal || Ci.nsIDOMWindow);
|
|
|
|
} else {
|
|
|
|
domWindow = appWindow;
|
|
|
|
appWindow = null;
|
|
|
|
}
|
2020-09-30 10:36:46 +03:00
|
|
|
if (!(domWindow instanceof Ci.nsIDOMChromeWindow))
|
|
|
|
return;
|
2020-09-30 12:10:34 +03:00
|
|
|
// In persistent mode, window might be opened long ago and might be
|
|
|
|
// already initialized.
|
|
|
|
//
|
|
|
|
// In this case, we want to keep this callback synchronous so that we will call
|
|
|
|
// `onTabOpenListener` synchronously and before the sync IPc message `juggler:content-ready`.
|
|
|
|
if (domWindow.document.readyState === 'uninitialized' || domWindow.document.readyState === 'loading') {
|
|
|
|
// For non-initialized windows, DOMContentLoaded initializes gBrowser
|
|
|
|
// and starts tab loading (see //browser/base/content/browser.js), so we
|
|
|
|
// are guaranteed to call `onTabOpenListener` before the sync IPC message
|
|
|
|
// `juggler:content-ready`.
|
|
|
|
await helper.awaitEvent(domWindow, 'DOMContentLoaded');
|
|
|
|
}
|
2020-09-30 10:36:46 +03:00
|
|
|
|
|
|
|
if (!domWindow.gBrowser)
|
|
|
|
return;
|
|
|
|
const tabContainer = domWindow.gBrowser.tabContainer;
|
|
|
|
domWindowTabListeners.set(domWindow, [
|
|
|
|
helper.addEventListener(tabContainer, 'TabOpen', event => onTabOpenListener(appWindow, domWindow, event)),
|
|
|
|
helper.addEventListener(tabContainer, 'TabClose', onTabCloseListener),
|
|
|
|
]);
|
|
|
|
for (const tab of domWindow.gBrowser.tabs)
|
|
|
|
onTabOpenListener(appWindow, domWindow, { target: tab });
|
|
|
|
};
|
|
|
|
|
|
|
|
const onCloseWindow = window => {
|
|
|
|
const domWindow = window.QueryInterface(Ci.nsIInterfaceRequestor).getInterface(Ci.nsIDOMWindowInternal || Ci.nsIDOMWindow);
|
|
|
|
if (!(domWindow instanceof Ci.nsIDOMChromeWindow))
|
|
|
|
return;
|
|
|
|
if (!domWindow.gBrowser)
|
|
|
|
return;
|
|
|
|
|
|
|
|
const listeners = domWindowTabListeners.get(domWindow) || [];
|
|
|
|
domWindowTabListeners.delete(domWindow);
|
|
|
|
helper.removeListeners(listeners);
|
|
|
|
for (const tab of domWindow.gBrowser.tabs)
|
|
|
|
onTabCloseListener({ target: tab });
|
|
|
|
};
|
|
|
|
|
2020-09-30 12:10:34 +03:00
|
|
|
const extHelperAppSvc = Cc["@mozilla.org/uriloader/external-helper-app-service;1"].getService(Ci.nsIExternalHelperAppService);
|
|
|
|
extHelperAppSvc.setDownloadInterceptor(new DownloadInterceptor(this));
|
|
|
|
|
2020-09-30 10:36:46 +03:00
|
|
|
Services.wm.addListener({ onOpenWindow, onCloseWindow });
|
|
|
|
for (const win of Services.wm.getEnumerator(null))
|
|
|
|
onOpenWindow(win);
|
2020-06-03 02:51:13 +03:00
|
|
|
}
|
|
|
|
|
2020-08-08 01:38:06 +03:00
|
|
|
setBrowserProxy(proxy) {
|
|
|
|
this._browserProxy = proxy;
|
|
|
|
}
|
|
|
|
|
|
|
|
getProxyInfo(channel) {
|
|
|
|
const originAttributes = channel.loadInfo && channel.loadInfo.originAttributes;
|
|
|
|
const browserContext = originAttributes ? this.browserContextForUserContextId(originAttributes.userContextId) : null;
|
|
|
|
// Prefer context proxy and fallback to browser-level proxy.
|
|
|
|
const proxyInfo = (browserContext && browserContext._proxy) || this._browserProxy;
|
|
|
|
if (!proxyInfo || proxyInfo.bypass.some(domainSuffix => channel.URI.host.endsWith(domainSuffix)))
|
|
|
|
return null;
|
|
|
|
return proxyInfo;
|
|
|
|
}
|
|
|
|
|
2020-06-03 02:51:13 +03:00
|
|
|
defaultContext() {
|
|
|
|
return this._defaultContext;
|
|
|
|
}
|
|
|
|
|
|
|
|
createBrowserContext(removeOnDetach) {
|
|
|
|
return new BrowserContext(this, helper.generateId(), removeOnDetach);
|
|
|
|
}
|
|
|
|
|
|
|
|
browserContextForId(browserContextId) {
|
|
|
|
return this._browserContextIdToBrowserContext.get(browserContextId);
|
|
|
|
}
|
|
|
|
|
2020-06-04 18:52:43 +03:00
|
|
|
browserContextForUserContextId(userContextId) {
|
|
|
|
return this._userContextIdToBrowserContext.get(userContextId);
|
|
|
|
}
|
|
|
|
|
2020-06-03 02:51:13 +03:00
|
|
|
async newPage({browserContextId}) {
|
|
|
|
const browserContext = this.browserContextForId(browserContextId);
|
2020-07-03 00:46:57 +03:00
|
|
|
const features = "chrome,dialog=no,all";
|
|
|
|
// See _callWithURIToLoad in browser.js for the structure of window.arguments
|
|
|
|
// window.arguments[1]: unused (bug 871161)
|
|
|
|
// [2]: referrerInfo (nsIReferrerInfo)
|
|
|
|
// [3]: postData (nsIInputStream)
|
|
|
|
// [4]: allowThirdPartyFixup (bool)
|
|
|
|
// [5]: userContextId (int)
|
|
|
|
// [6]: originPrincipal (nsIPrincipal)
|
|
|
|
// [7]: originStoragePrincipal (nsIPrincipal)
|
|
|
|
// [8]: triggeringPrincipal (nsIPrincipal)
|
|
|
|
// [9]: allowInheritPrincipal (bool)
|
|
|
|
// [10]: csp (nsIContentSecurityPolicy)
|
|
|
|
// [11]: nsOpenWindowInfo
|
|
|
|
const args = Cc["@mozilla.org/array;1"].createInstance(Ci.nsIMutableArray);
|
|
|
|
const urlSupports = Cc["@mozilla.org/supports-string;1"].createInstance(
|
|
|
|
Ci.nsISupportsString
|
|
|
|
);
|
|
|
|
urlSupports.data = 'about:blank';
|
|
|
|
args.appendElement(urlSupports); // 0
|
|
|
|
args.appendElement(undefined); // 1
|
|
|
|
args.appendElement(undefined); // 2
|
|
|
|
args.appendElement(undefined); // 3
|
|
|
|
args.appendElement(undefined); // 4
|
|
|
|
const userContextIdSupports = Cc[
|
|
|
|
"@mozilla.org/supports-PRUint32;1"
|
|
|
|
].createInstance(Ci.nsISupportsPRUint32);
|
|
|
|
userContextIdSupports.data = browserContext.userContextId;
|
|
|
|
args.appendElement(userContextIdSupports); // 5
|
|
|
|
args.appendElement(undefined); // 6
|
|
|
|
args.appendElement(undefined); // 7
|
|
|
|
args.appendElement(Services.scriptSecurityManager.getSystemPrincipal()); // 8
|
|
|
|
|
|
|
|
const window = Services.ww.openWindow(null, AppConstants.BROWSER_CHROME_URL, '_blank', features, args);
|
|
|
|
await waitForWindowReady(window);
|
|
|
|
if (window.gBrowser.browsers.length !== 1)
|
2020-09-30 10:36:46 +03:00
|
|
|
throw new Error(`Unexpected number of tabs in the new window: ${window.gBrowser.browsers.length}`);
|
2020-07-03 00:46:57 +03:00
|
|
|
const browser = window.gBrowser.browsers[0];
|
2020-09-30 12:10:34 +03:00
|
|
|
const target = this._browserToTarget.get(browser);
|
2020-07-03 00:46:57 +03:00
|
|
|
browser.focus();
|
2020-06-03 02:51:13 +03:00
|
|
|
if (browserContext.settings.timezoneId) {
|
|
|
|
if (await target.hasFailedToOverrideTimezone())
|
|
|
|
throw new Error('Failed to override timezone');
|
|
|
|
}
|
|
|
|
return target.id();
|
|
|
|
}
|
|
|
|
|
2020-10-02 14:13:42 +03:00
|
|
|
targets() {
|
|
|
|
return Array.from(this._browserToTarget.values());
|
2020-06-03 02:51:13 +03:00
|
|
|
}
|
|
|
|
|
|
|
|
targetForBrowser(browser) {
|
|
|
|
return this._browserToTarget.get(browser);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
class PageTarget {
|
2020-09-30 12:10:34 +03:00
|
|
|
constructor(registry, win, tab, browserContext, opener) {
|
2020-06-03 02:51:13 +03:00
|
|
|
EventEmitter.decorate(this);
|
|
|
|
|
|
|
|
this._targetId = helper.generateId();
|
|
|
|
this._registry = registry;
|
2020-07-08 00:04:07 +03:00
|
|
|
this._window = win;
|
2020-09-30 12:10:34 +03:00
|
|
|
this._gBrowser = win.gBrowser;
|
2020-06-03 02:51:13 +03:00
|
|
|
this._tab = tab;
|
2020-09-30 12:10:34 +03:00
|
|
|
this._linkedBrowser = tab.linkedBrowser;
|
2020-06-03 02:51:13 +03:00
|
|
|
this._browserContext = browserContext;
|
|
|
|
this._viewportSize = undefined;
|
2021-03-03 05:52:19 +03:00
|
|
|
this._initialDPPX = this._linkedBrowser.browsingContext.overrideDPPX;
|
2020-06-03 02:51:13 +03:00
|
|
|
this._url = 'about:blank';
|
|
|
|
this._openerId = opener ? opener.id() : undefined;
|
|
|
|
this._channel = SimpleChannel.createForMessageManager(`browser::page[${this._targetId}]`, this._linkedBrowser.messageManager);
|
2021-05-07 05:11:42 +03:00
|
|
|
this._videoRecordingInfo = undefined;
|
|
|
|
this._screencastRecordingInfo = undefined;
|
2020-10-06 11:53:25 +03:00
|
|
|
this._dialogs = new Map();
|
2020-06-03 02:51:13 +03:00
|
|
|
|
|
|
|
const navigationListener = {
|
2020-08-06 20:32:50 +03:00
|
|
|
QueryInterface: ChromeUtils.generateQI([Ci.nsIWebProgressListener, Ci.nsISupportsWeakReference]),
|
2020-06-03 02:51:13 +03:00
|
|
|
onLocationChange: (aWebProgress, aRequest, aLocation) => this._onNavigated(aLocation),
|
|
|
|
};
|
|
|
|
this._eventListeners = [
|
2020-10-29 00:47:14 +03:00
|
|
|
helper.addObserver(this._updateModalDialogs.bind(this), 'tabmodal-dialog-loaded'),
|
2020-06-03 02:51:13 +03:00
|
|
|
helper.addProgressListener(tab.linkedBrowser, navigationListener, Ci.nsIWebProgress.NOTIFY_LOCATION),
|
2020-10-06 11:53:25 +03:00
|
|
|
helper.addEventListener(this._linkedBrowser, 'DOMModalDialogClosed', event => this._updateModalDialogs()),
|
2020-06-03 02:51:13 +03:00
|
|
|
];
|
|
|
|
|
|
|
|
this._disposed = false;
|
2020-08-20 01:39:46 +03:00
|
|
|
browserContext.pages.add(this);
|
2020-06-03 02:51:13 +03:00
|
|
|
this._registry._browserToTarget.set(this._linkedBrowser, this);
|
|
|
|
this._registry._browserBrowsingContextToTarget.set(this._linkedBrowser.browsingContext, this);
|
2020-09-11 00:37:48 +03:00
|
|
|
|
2020-10-02 14:13:42 +03:00
|
|
|
this._registry.emit(TargetRegistry.Events.TargetCreated, this);
|
2020-09-30 12:10:34 +03:00
|
|
|
}
|
|
|
|
|
2020-10-06 11:53:25 +03:00
|
|
|
dialog(dialogId) {
|
|
|
|
return this._dialogs.get(dialogId);
|
|
|
|
}
|
|
|
|
|
|
|
|
dialogs() {
|
|
|
|
return [...this._dialogs.values()];
|
|
|
|
}
|
|
|
|
|
2020-09-11 00:37:48 +03:00
|
|
|
async windowReady() {
|
|
|
|
await waitForWindowReady(this._window);
|
2020-06-03 02:51:13 +03:00
|
|
|
}
|
|
|
|
|
|
|
|
linkedBrowser() {
|
|
|
|
return this._linkedBrowser;
|
|
|
|
}
|
|
|
|
|
|
|
|
browserContext() {
|
|
|
|
return this._browserContext;
|
|
|
|
}
|
|
|
|
|
2020-11-18 19:19:09 +03:00
|
|
|
updateTouchOverride() {
|
|
|
|
this._linkedBrowser.browsingContext.touchEventsOverride = this._browserContext.touchOverride ? 'enabled' : 'none';
|
|
|
|
}
|
|
|
|
|
2020-09-30 18:02:22 +03:00
|
|
|
updateUserAgent() {
|
|
|
|
this._linkedBrowser.browsingContext.customUserAgent = this._browserContext.defaultUserAgent;
|
|
|
|
}
|
|
|
|
|
2020-10-06 11:53:25 +03:00
|
|
|
_updateModalDialogs() {
|
|
|
|
const prompts = new Set(this._linkedBrowser.tabModalPromptBox ? this._linkedBrowser.tabModalPromptBox.listPrompts() : []);
|
|
|
|
for (const dialog of this._dialogs.values()) {
|
|
|
|
if (!prompts.has(dialog.prompt())) {
|
|
|
|
this._dialogs.delete(dialog.id());
|
|
|
|
this.emit(PageTarget.Events.DialogClosed, dialog);
|
|
|
|
} else {
|
|
|
|
prompts.delete(dialog.prompt());
|
|
|
|
}
|
|
|
|
}
|
|
|
|
for (const prompt of prompts) {
|
|
|
|
const dialog = Dialog.createIfSupported(prompt);
|
|
|
|
if (!dialog)
|
|
|
|
continue;
|
|
|
|
this._dialogs.set(dialog.id(), dialog);
|
|
|
|
this.emit(PageTarget.Events.DialogOpened, dialog);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2020-09-30 12:10:34 +03:00
|
|
|
async updateViewportSize() {
|
|
|
|
// Viewport size is defined by three arguments:
|
|
|
|
// 1. default size. Could be explicit if set as part of `window.open` call, e.g.
|
|
|
|
// `window.open(url, title, 'width=400,height=400')`
|
|
|
|
// 2. page viewport size
|
|
|
|
// 3. browserContext viewport size
|
|
|
|
//
|
|
|
|
// The "default size" (1) is only respected when the page is opened.
|
|
|
|
// Otherwise, explicitly set page viewport prevales over browser context
|
|
|
|
// default viewport.
|
|
|
|
const viewportSize = this._viewportSize || this._browserContext.defaultViewportSize;
|
2020-10-02 14:13:42 +03:00
|
|
|
const actualSize = await setViewportSizeForBrowser(viewportSize, this._linkedBrowser, this._window);
|
2021-03-03 05:52:19 +03:00
|
|
|
this._linkedBrowser.browsingContext.overrideDPPX = this._browserContext.deviceScaleFactor || this._initialDPPX;
|
2020-06-03 02:51:13 +03:00
|
|
|
await this._channel.connect('').send('awaitViewportDimensions', {
|
|
|
|
width: actualSize.width,
|
2021-03-03 05:52:19 +03:00
|
|
|
height: actualSize.height,
|
|
|
|
deviceSizeIsPageSize: !!this._browserContext.deviceScaleFactor,
|
2020-06-03 02:51:13 +03:00
|
|
|
});
|
|
|
|
}
|
|
|
|
|
2021-03-03 05:52:19 +03:00
|
|
|
setEmulatedMedia(mediumOverride) {
|
|
|
|
this._linkedBrowser.browsingContext.mediumOverride = mediumOverride || '';
|
|
|
|
}
|
|
|
|
|
|
|
|
setColorScheme(colorScheme) {
|
|
|
|
this.colorScheme = fromProtocolColorScheme(colorScheme);
|
|
|
|
this.updateColorSchemeOverride();
|
|
|
|
}
|
|
|
|
|
|
|
|
updateColorSchemeOverride() {
|
|
|
|
this._linkedBrowser.browsingContext.prefersColorSchemeOverride = this.colorScheme || this._browserContext.colorScheme || 'none';
|
|
|
|
}
|
|
|
|
|
|
|
|
|
2020-09-30 12:10:34 +03:00
|
|
|
async setViewportSize(viewportSize) {
|
|
|
|
this._viewportSize = viewportSize;
|
|
|
|
await this.updateViewportSize();
|
|
|
|
}
|
|
|
|
|
2020-11-03 04:29:54 +03:00
|
|
|
close(runBeforeUnload = false) {
|
|
|
|
this._gBrowser.removeTab(this._tab, {
|
2020-06-03 02:51:13 +03:00
|
|
|
skipPermitUnload: !runBeforeUnload,
|
|
|
|
});
|
|
|
|
}
|
|
|
|
|
2020-10-02 14:13:42 +03:00
|
|
|
channel() {
|
|
|
|
return this._channel;
|
2020-06-03 02:51:13 +03:00
|
|
|
}
|
|
|
|
|
|
|
|
id() {
|
|
|
|
return this._targetId;
|
|
|
|
}
|
|
|
|
|
|
|
|
info() {
|
|
|
|
return {
|
|
|
|
targetId: this.id(),
|
|
|
|
type: 'page',
|
2020-08-20 01:39:46 +03:00
|
|
|
browserContextId: this._browserContext.browserContextId,
|
2020-06-03 02:51:13 +03:00
|
|
|
openerId: this._openerId,
|
|
|
|
};
|
|
|
|
}
|
|
|
|
|
|
|
|
_onNavigated(aLocation) {
|
|
|
|
this._url = aLocation.spec;
|
|
|
|
this._browserContext.grantPermissionsToOrigin(this._url);
|
|
|
|
}
|
|
|
|
|
|
|
|
async ensurePermissions() {
|
|
|
|
await this._channel.connect('').send('ensurePermissions', {}).catch(e => void e);
|
|
|
|
}
|
|
|
|
|
|
|
|
async addScriptToEvaluateOnNewDocument(script) {
|
|
|
|
await this._channel.connect('').send('addScriptToEvaluateOnNewDocument', script).catch(e => void e);
|
|
|
|
}
|
|
|
|
|
2021-05-11 19:27:39 +03:00
|
|
|
async addBinding(worldName, name, script) {
|
|
|
|
await this._channel.connect('').send('addBinding', { worldName, name, script }).catch(e => void e);
|
2020-06-03 02:51:13 +03:00
|
|
|
}
|
|
|
|
|
|
|
|
async applyContextSetting(name, value) {
|
|
|
|
await this._channel.connect('').send('applyContextSetting', { name, value }).catch(e => void e);
|
|
|
|
}
|
|
|
|
|
|
|
|
async hasFailedToOverrideTimezone() {
|
|
|
|
return await this._channel.connect('').send('hasFailedToOverrideTimezone').catch(e => true);
|
|
|
|
}
|
|
|
|
|
2021-05-05 23:27:51 +03:00
|
|
|
async _startVideoRecording({width, height, dir}) {
|
2020-10-03 03:16:49 +03:00
|
|
|
// On Mac the window may not yet be visible when TargetCreated and its
|
|
|
|
// NSWindow.windowNumber may be -1, so we wait until the window is known
|
|
|
|
// to be initialized and visible.
|
|
|
|
await this.windowReady();
|
|
|
|
const file = OS.Path.join(dir, helper.generateId() + '.webm');
|
|
|
|
if (width < 10 || width > 10000 || height < 10 || height > 10000)
|
|
|
|
throw new Error("Invalid size");
|
|
|
|
|
|
|
|
const docShell = this._gBrowser.ownerGlobal.docShell;
|
|
|
|
// Exclude address bar and navigation control from the video.
|
|
|
|
const rect = this.linkedBrowser().getBoundingClientRect();
|
|
|
|
const devicePixelRatio = this._window.devicePixelRatio;
|
2021-05-08 04:05:26 +03:00
|
|
|
let sessionId;
|
|
|
|
const registry = this._registry;
|
|
|
|
const screencastClient = {
|
|
|
|
QueryInterface: ChromeUtils.generateQI([Ci.nsIScreencastServiceClient]),
|
|
|
|
screencastFrame(data, deviceWidth, deviceHeight) {
|
|
|
|
},
|
|
|
|
screencastStopped() {
|
|
|
|
registry.emit(TargetRegistry.Events.ScreencastStopped, sessionId);
|
|
|
|
},
|
|
|
|
};
|
2021-05-11 08:01:41 +03:00
|
|
|
const viewport = this._viewportSize || this._browserContext.defaultViewportSize || { width: 0, height: 0 };
|
|
|
|
sessionId = screencastService.startVideoRecording(screencastClient, docShell, true, file, width, height, 0, viewport.width, viewport.height, devicePixelRatio * rect.top);
|
2021-05-07 05:11:42 +03:00
|
|
|
this._videoRecordingInfo = { sessionId, file };
|
2020-10-06 11:53:25 +03:00
|
|
|
this.emit(PageTarget.Events.ScreencastStarted);
|
2020-10-03 03:16:49 +03:00
|
|
|
}
|
|
|
|
|
2021-05-07 05:11:42 +03:00
|
|
|
_stopVideoRecording() {
|
|
|
|
if (!this._videoRecordingInfo)
|
2020-10-03 03:16:49 +03:00
|
|
|
throw new Error('No video recording in progress');
|
2021-05-07 05:11:42 +03:00
|
|
|
const videoRecordingInfo = this._videoRecordingInfo;
|
|
|
|
this._videoRecordingInfo = undefined;
|
2021-05-08 04:05:26 +03:00
|
|
|
screencastService.stopVideoRecording(videoRecordingInfo.sessionId);
|
2021-05-07 05:11:42 +03:00
|
|
|
}
|
2020-10-03 03:16:49 +03:00
|
|
|
|
2021-05-07 05:11:42 +03:00
|
|
|
videoRecordingInfo() {
|
|
|
|
return this._videoRecordingInfo;
|
|
|
|
}
|
|
|
|
|
|
|
|
async startScreencast({ width, height, quality }) {
|
|
|
|
// On Mac the window may not yet be visible when TargetCreated and its
|
|
|
|
// NSWindow.windowNumber may be -1, so we wait until the window is known
|
|
|
|
// to be initialized and visible.
|
|
|
|
await this.windowReady();
|
|
|
|
if (width < 10 || width > 10000 || height < 10 || height > 10000)
|
|
|
|
throw new Error("Invalid size");
|
|
|
|
|
|
|
|
const docShell = this._gBrowser.ownerGlobal.docShell;
|
|
|
|
// Exclude address bar and navigation control from the video.
|
|
|
|
const rect = this.linkedBrowser().getBoundingClientRect();
|
|
|
|
const devicePixelRatio = this._window.devicePixelRatio;
|
2021-05-08 04:05:26 +03:00
|
|
|
|
|
|
|
const self = this;
|
|
|
|
const screencastClient = {
|
|
|
|
QueryInterface: ChromeUtils.generateQI([Ci.nsIScreencastServiceClient]),
|
|
|
|
screencastFrame(data, deviceWidth, deviceHeight) {
|
|
|
|
if (self._screencastRecordingInfo)
|
|
|
|
self.emit(PageTarget.Events.ScreencastFrame, { data, deviceWidth, deviceHeight });
|
|
|
|
},
|
|
|
|
screencastStopped() {
|
|
|
|
},
|
2021-05-07 05:11:42 +03:00
|
|
|
};
|
2021-05-11 08:01:41 +03:00
|
|
|
const viewport = this._viewportSize || this._browserContext.defaultViewportSize || { width: 0, height: 0 };
|
|
|
|
const screencastId = screencastService.startVideoRecording(screencastClient, docShell, false, '', width, height, quality || 90, viewport.width, viewport.height, devicePixelRatio * rect.top);
|
2021-05-08 04:05:26 +03:00
|
|
|
this._screencastRecordingInfo = { screencastId };
|
2021-05-07 05:11:42 +03:00
|
|
|
return { screencastId };
|
|
|
|
}
|
|
|
|
|
|
|
|
screencastFrameAck({ screencastId }) {
|
|
|
|
if (!this._screencastRecordingInfo || this._screencastRecordingInfo.screencastId !== screencastId)
|
|
|
|
return;
|
2021-05-08 04:05:26 +03:00
|
|
|
screencastService.screencastFrameAck(screencastId);
|
2020-10-03 03:16:49 +03:00
|
|
|
}
|
|
|
|
|
2021-05-07 05:11:42 +03:00
|
|
|
stopScreencast() {
|
|
|
|
if (!this._screencastRecordingInfo)
|
|
|
|
throw new Error('No screencast in progress');
|
2021-05-08 04:05:26 +03:00
|
|
|
const { screencastId } = this._screencastRecordingInfo;
|
2021-05-07 05:11:42 +03:00
|
|
|
this._screencastRecordingInfo = undefined;
|
2021-05-08 04:05:26 +03:00
|
|
|
screencastService.stopVideoRecording(screencastId);
|
2020-10-03 03:16:49 +03:00
|
|
|
}
|
|
|
|
|
2020-08-26 00:50:40 +03:00
|
|
|
dispose() {
|
2020-06-03 02:51:13 +03:00
|
|
|
this._disposed = true;
|
2021-05-07 05:11:42 +03:00
|
|
|
if (this._videoRecordingInfo)
|
|
|
|
this._stopVideoRecording();
|
|
|
|
if (this._screencastRecordingInfo)
|
|
|
|
this.stopScreencast();
|
2020-08-26 00:50:40 +03:00
|
|
|
this._browserContext.pages.delete(this);
|
2020-06-03 02:51:13 +03:00
|
|
|
this._registry._browserToTarget.delete(this._linkedBrowser);
|
|
|
|
this._registry._browserBrowsingContextToTarget.delete(this._linkedBrowser.browsingContext);
|
2020-11-20 21:48:06 +03:00
|
|
|
try {
|
|
|
|
helper.removeListeners(this._eventListeners);
|
|
|
|
} catch (e) {
|
|
|
|
// In some cases, removing listeners from this._linkedBrowser fails
|
|
|
|
// because it is already half-destroyed.
|
|
|
|
if (e)
|
|
|
|
dump(e.message + '\n' + e.stack + '\n');
|
|
|
|
}
|
2020-10-02 14:13:42 +03:00
|
|
|
this._registry.emit(TargetRegistry.Events.TargetDestroyed, this);
|
2020-06-03 02:51:13 +03:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2020-10-06 11:53:25 +03:00
|
|
|
PageTarget.Events = {
|
|
|
|
ScreencastStarted: Symbol('PageTarget.ScreencastStarted'),
|
2021-05-07 05:11:42 +03:00
|
|
|
ScreencastFrame: Symbol('PageTarget.ScreencastFrame'),
|
2020-10-06 11:53:25 +03:00
|
|
|
Crashed: Symbol('PageTarget.Crashed'),
|
|
|
|
DialogOpened: Symbol('PageTarget.DialogOpened'),
|
|
|
|
DialogClosed: Symbol('PageTarget.DialogClosed'),
|
|
|
|
};
|
|
|
|
|
2021-03-03 05:52:19 +03:00
|
|
|
function fromProtocolColorScheme(colorScheme) {
|
|
|
|
if (colorScheme === 'light' || colorScheme === 'dark')
|
|
|
|
return colorScheme;
|
|
|
|
if (colorScheme === null || colorScheme === 'no-preference')
|
|
|
|
return undefined;
|
|
|
|
throw new Error('Unknown color scheme: ' + colorScheme);
|
|
|
|
}
|
|
|
|
|
2020-06-03 02:51:13 +03:00
|
|
|
class BrowserContext {
|
|
|
|
constructor(registry, browserContextId, removeOnDetach) {
|
|
|
|
this._registry = registry;
|
|
|
|
this.browserContextId = browserContextId;
|
|
|
|
// Default context has userContextId === 0, but we pass undefined to many APIs just in case.
|
|
|
|
this.userContextId = 0;
|
|
|
|
if (browserContextId !== undefined) {
|
|
|
|
const identity = ContextualIdentityService.create(IDENTITY_NAME + browserContextId);
|
|
|
|
this.userContextId = identity.userContextId;
|
|
|
|
}
|
|
|
|
this._principals = [];
|
|
|
|
// Maps origins to the permission lists.
|
|
|
|
this._permissions = new Map();
|
|
|
|
this._registry._browserContextIdToBrowserContext.set(this.browserContextId, this);
|
|
|
|
this._registry._userContextIdToBrowserContext.set(this.userContextId, this);
|
2020-08-08 01:38:06 +03:00
|
|
|
this._proxy = null;
|
2020-06-03 02:51:13 +03:00
|
|
|
this.removeOnDetach = removeOnDetach;
|
|
|
|
this.extraHTTPHeaders = undefined;
|
|
|
|
this.httpCredentials = undefined;
|
|
|
|
this.requestInterceptionEnabled = undefined;
|
|
|
|
this.ignoreHTTPSErrors = undefined;
|
|
|
|
this.downloadOptions = undefined;
|
|
|
|
this.defaultViewportSize = undefined;
|
2021-03-03 05:52:19 +03:00
|
|
|
this.deviceScaleFactor = undefined;
|
2020-09-30 18:02:22 +03:00
|
|
|
this.defaultUserAgent = null;
|
2020-11-18 19:19:09 +03:00
|
|
|
this.touchOverride = false;
|
2021-03-03 05:52:19 +03:00
|
|
|
this.colorScheme = 'none';
|
2021-05-07 05:11:42 +03:00
|
|
|
this.videoRecordingOptions = undefined;
|
2020-06-03 02:51:13 +03:00
|
|
|
this.scriptsToEvaluateOnNewDocument = [];
|
|
|
|
this.bindings = [];
|
|
|
|
this.settings = {};
|
|
|
|
this.pages = new Set();
|
|
|
|
}
|
|
|
|
|
2021-03-03 05:52:19 +03:00
|
|
|
setColorScheme(colorScheme) {
|
|
|
|
this.colorScheme = fromProtocolColorScheme(colorScheme);
|
|
|
|
for (const page of this.pages)
|
|
|
|
page.updateColorSchemeOverride();
|
|
|
|
}
|
|
|
|
|
2020-06-03 02:51:13 +03:00
|
|
|
async destroy() {
|
|
|
|
if (this.userContextId !== 0) {
|
|
|
|
ContextualIdentityService.remove(this.userContextId);
|
2020-11-03 04:29:54 +03:00
|
|
|
for (const page of this.pages)
|
|
|
|
page.close();
|
2020-06-03 02:51:13 +03:00
|
|
|
if (this.pages.size) {
|
|
|
|
await new Promise(f => {
|
|
|
|
const listener = helper.on(this._registry, TargetRegistry.Events.TargetDestroyed, () => {
|
|
|
|
if (!this.pages.size) {
|
|
|
|
helper.removeListeners([listener]);
|
|
|
|
f();
|
|
|
|
}
|
|
|
|
});
|
|
|
|
});
|
|
|
|
}
|
|
|
|
}
|
|
|
|
this._registry._browserContextIdToBrowserContext.delete(this.browserContextId);
|
|
|
|
this._registry._userContextIdToBrowserContext.delete(this.userContextId);
|
|
|
|
}
|
|
|
|
|
2020-08-08 01:38:06 +03:00
|
|
|
setProxy(proxy) {
|
2020-12-22 02:54:15 +03:00
|
|
|
// Clear AuthCache.
|
|
|
|
Services.obs.notifyObservers(null, "net:clear-active-logins");
|
2020-08-08 01:38:06 +03:00
|
|
|
this._proxy = proxy;
|
|
|
|
}
|
|
|
|
|
2020-06-03 02:51:13 +03:00
|
|
|
setIgnoreHTTPSErrors(ignoreHTTPSErrors) {
|
|
|
|
if (this.ignoreHTTPSErrors === ignoreHTTPSErrors)
|
|
|
|
return;
|
|
|
|
this.ignoreHTTPSErrors = ignoreHTTPSErrors;
|
|
|
|
const certOverrideService = Cc[
|
|
|
|
"@mozilla.org/security/certoverride;1"
|
|
|
|
].getService(Ci.nsICertOverrideService);
|
|
|
|
if (ignoreHTTPSErrors) {
|
|
|
|
Preferences.set("network.stricttransportsecurity.preloadlist", false);
|
|
|
|
Preferences.set("security.cert_pinning.enforcement_level", 0);
|
|
|
|
certOverrideService.setDisableAllSecurityChecksAndLetAttackersInterceptMyData(true, this.userContextId);
|
|
|
|
} else {
|
|
|
|
certOverrideService.setDisableAllSecurityChecksAndLetAttackersInterceptMyData(false, this.userContextId);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2020-09-30 18:02:22 +03:00
|
|
|
async setDefaultUserAgent(userAgent) {
|
|
|
|
this.defaultUserAgent = userAgent;
|
|
|
|
for (const page of this.pages)
|
|
|
|
page.updateUserAgent();
|
|
|
|
}
|
|
|
|
|
2020-11-18 19:19:09 +03:00
|
|
|
setTouchOverride(touchOverride) {
|
|
|
|
this.touchOverride = touchOverride;
|
|
|
|
for (const page of this.pages)
|
|
|
|
page.updateTouchOverride();
|
|
|
|
}
|
|
|
|
|
2020-06-03 02:51:13 +03:00
|
|
|
async setDefaultViewport(viewport) {
|
|
|
|
this.defaultViewportSize = viewport ? viewport.viewportSize : undefined;
|
2021-03-03 05:52:19 +03:00
|
|
|
this.deviceScaleFactor = viewport ? viewport.deviceScaleFactor : undefined;
|
|
|
|
await Promise.all(Array.from(this.pages).map(page => page.updateViewportSize()));
|
2020-06-03 02:51:13 +03:00
|
|
|
}
|
|
|
|
|
|
|
|
async addScriptToEvaluateOnNewDocument(script) {
|
|
|
|
this.scriptsToEvaluateOnNewDocument.push(script);
|
|
|
|
await Promise.all(Array.from(this.pages).map(page => page.addScriptToEvaluateOnNewDocument(script)));
|
|
|
|
}
|
|
|
|
|
2021-05-11 19:27:39 +03:00
|
|
|
async addBinding(worldName, name, script) {
|
|
|
|
this.bindings.push({ worldName, name, script });
|
|
|
|
await Promise.all(Array.from(this.pages).map(page => page.addBinding(worldName, name, script)));
|
2020-06-03 02:51:13 +03:00
|
|
|
}
|
|
|
|
|
|
|
|
async applySetting(name, value) {
|
|
|
|
this.settings[name] = value;
|
|
|
|
await Promise.all(Array.from(this.pages).map(page => page.applyContextSetting(name, value)));
|
|
|
|
}
|
|
|
|
|
|
|
|
async grantPermissions(origin, permissions) {
|
|
|
|
this._permissions.set(origin, permissions);
|
|
|
|
const promises = [];
|
|
|
|
for (const page of this.pages) {
|
|
|
|
if (origin === '*' || page._url.startsWith(origin)) {
|
|
|
|
this.grantPermissionsToOrigin(page._url);
|
|
|
|
promises.push(page.ensurePermissions());
|
|
|
|
}
|
|
|
|
}
|
|
|
|
await Promise.all(promises);
|
|
|
|
}
|
|
|
|
|
|
|
|
resetPermissions() {
|
|
|
|
for (const principal of this._principals) {
|
|
|
|
for (const permission of ALL_PERMISSIONS)
|
|
|
|
Services.perms.removeFromPrincipal(principal, permission);
|
|
|
|
}
|
|
|
|
this._principals = [];
|
|
|
|
this._permissions.clear();
|
|
|
|
}
|
|
|
|
|
|
|
|
grantPermissionsToOrigin(url) {
|
|
|
|
let origin = Array.from(this._permissions.keys()).find(key => url.startsWith(key));
|
|
|
|
if (!origin)
|
|
|
|
origin = '*';
|
|
|
|
|
|
|
|
const permissions = this._permissions.get(origin);
|
|
|
|
if (!permissions)
|
|
|
|
return;
|
|
|
|
|
|
|
|
const attrs = { userContextId: this.userContextId || undefined };
|
|
|
|
const principal = Services.scriptSecurityManager.createContentPrincipal(NetUtil.newURI(url), attrs);
|
|
|
|
this._principals.push(principal);
|
|
|
|
for (const permission of ALL_PERMISSIONS) {
|
|
|
|
const action = permissions.includes(permission) ? Ci.nsIPermissionManager.ALLOW_ACTION : Ci.nsIPermissionManager.DENY_ACTION;
|
|
|
|
Services.perms.addFromPrincipal(principal, permission, action, Ci.nsIPermissionManager.EXPIRE_NEVER, 0 /* expireTime */);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
setCookies(cookies) {
|
|
|
|
const protocolToSameSite = {
|
|
|
|
[undefined]: Ci.nsICookie.SAMESITE_NONE,
|
|
|
|
'Lax': Ci.nsICookie.SAMESITE_LAX,
|
|
|
|
'Strict': Ci.nsICookie.SAMESITE_STRICT,
|
|
|
|
};
|
|
|
|
for (const cookie of cookies) {
|
|
|
|
const uri = cookie.url ? NetUtil.newURI(cookie.url) : null;
|
|
|
|
let domain = cookie.domain;
|
|
|
|
if (!domain) {
|
|
|
|
if (!uri)
|
|
|
|
throw new Error('At least one of the url and domain needs to be specified');
|
|
|
|
domain = uri.host;
|
|
|
|
}
|
|
|
|
let path = cookie.path;
|
|
|
|
if (!path)
|
|
|
|
path = uri ? dirPath(uri.filePath) : '/';
|
|
|
|
let secure = false;
|
|
|
|
if (cookie.secure !== undefined)
|
|
|
|
secure = cookie.secure;
|
|
|
|
else if (uri && uri.scheme === 'https')
|
|
|
|
secure = true;
|
|
|
|
Services.cookies.add(
|
|
|
|
domain,
|
|
|
|
path,
|
|
|
|
cookie.name,
|
|
|
|
cookie.value,
|
|
|
|
secure,
|
|
|
|
cookie.httpOnly || false,
|
|
|
|
cookie.expires === undefined || cookie.expires === -1 /* isSession */,
|
|
|
|
cookie.expires === undefined ? Date.now() + HUNDRED_YEARS : cookie.expires,
|
|
|
|
{ userContextId: this.userContextId || undefined } /* originAttributes */,
|
|
|
|
protocolToSameSite[cookie.sameSite],
|
2020-08-06 20:32:50 +03:00
|
|
|
Ci.nsICookie.SCHEME_UNSET
|
2020-06-03 02:51:13 +03:00
|
|
|
);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
clearCookies() {
|
|
|
|
Services.cookies.removeCookiesWithOriginAttributes(JSON.stringify({ userContextId: this.userContextId || undefined }));
|
|
|
|
}
|
|
|
|
|
|
|
|
getCookies() {
|
|
|
|
const result = [];
|
|
|
|
const sameSiteToProtocol = {
|
|
|
|
[Ci.nsICookie.SAMESITE_NONE]: 'None',
|
|
|
|
[Ci.nsICookie.SAMESITE_LAX]: 'Lax',
|
|
|
|
[Ci.nsICookie.SAMESITE_STRICT]: 'Strict',
|
|
|
|
};
|
|
|
|
for (let cookie of Services.cookies.cookies) {
|
|
|
|
if (cookie.originAttributes.userContextId !== this.userContextId)
|
|
|
|
continue;
|
|
|
|
if (cookie.host === 'addons.mozilla.org')
|
|
|
|
continue;
|
|
|
|
result.push({
|
|
|
|
name: cookie.name,
|
|
|
|
value: cookie.value,
|
|
|
|
domain: cookie.host,
|
|
|
|
path: cookie.path,
|
|
|
|
expires: cookie.isSession ? -1 : cookie.expiry,
|
|
|
|
size: cookie.name.length + cookie.value.length,
|
|
|
|
httpOnly: cookie.isHttpOnly,
|
|
|
|
secure: cookie.isSecure,
|
|
|
|
session: cookie.isSession,
|
|
|
|
sameSite: sameSiteToProtocol[cookie.sameSite],
|
|
|
|
});
|
|
|
|
}
|
|
|
|
return result;
|
|
|
|
}
|
2020-08-19 22:43:53 +03:00
|
|
|
|
2021-05-07 05:11:42 +03:00
|
|
|
async setVideoRecordingOptions(options) {
|
|
|
|
this.videoRecordingOptions = options;
|
2020-10-03 03:16:49 +03:00
|
|
|
if (!options)
|
|
|
|
return;
|
|
|
|
const promises = [];
|
|
|
|
for (const page of this.pages)
|
2020-10-06 11:53:25 +03:00
|
|
|
promises.push(page._startVideoRecording(options));
|
2020-10-03 03:16:49 +03:00
|
|
|
await Promise.all(promises);
|
2020-08-19 22:43:53 +03:00
|
|
|
}
|
2020-06-03 02:51:13 +03:00
|
|
|
}
|
|
|
|
|
2020-10-06 11:53:25 +03:00
|
|
|
class Dialog {
|
|
|
|
static createIfSupported(prompt) {
|
|
|
|
const type = prompt.args.promptType;
|
|
|
|
switch (type) {
|
|
|
|
case 'alert':
|
2020-12-01 07:05:15 +03:00
|
|
|
case 'alertCheck':
|
|
|
|
return new Dialog(prompt, 'alert');
|
2020-10-06 11:53:25 +03:00
|
|
|
case 'prompt':
|
2020-12-01 07:05:15 +03:00
|
|
|
return new Dialog(prompt, 'prompt');
|
2020-10-06 11:53:25 +03:00
|
|
|
case 'confirm':
|
2020-12-01 07:05:15 +03:00
|
|
|
case 'confirmCheck':
|
|
|
|
return new Dialog(prompt, 'confirm');
|
2020-10-06 11:53:25 +03:00
|
|
|
case 'confirmEx':
|
|
|
|
return new Dialog(prompt, 'beforeunload');
|
|
|
|
default:
|
|
|
|
return null;
|
|
|
|
};
|
|
|
|
}
|
|
|
|
|
|
|
|
constructor(prompt, type) {
|
|
|
|
this._id = helper.generateId();
|
|
|
|
this._type = type;
|
|
|
|
this._prompt = prompt;
|
|
|
|
}
|
|
|
|
|
|
|
|
id() {
|
|
|
|
return this._id;
|
|
|
|
}
|
|
|
|
|
|
|
|
message() {
|
|
|
|
return this._prompt.ui.infoBody.textContent;
|
|
|
|
}
|
|
|
|
|
|
|
|
type() {
|
|
|
|
return this._type;
|
|
|
|
}
|
|
|
|
|
|
|
|
prompt() {
|
|
|
|
return this._prompt;
|
|
|
|
}
|
|
|
|
|
|
|
|
dismiss() {
|
|
|
|
if (this._prompt.ui.button1)
|
|
|
|
this._prompt.ui.button1.click();
|
|
|
|
else
|
|
|
|
this._prompt.ui.button0.click();
|
|
|
|
}
|
|
|
|
|
|
|
|
defaultValue() {
|
|
|
|
return this._prompt.ui.loginTextbox.value;
|
|
|
|
}
|
|
|
|
|
|
|
|
accept(promptValue) {
|
|
|
|
if (typeof promptValue === 'string' && this._type === 'prompt')
|
|
|
|
this._prompt.ui.loginTextbox.value = promptValue;
|
|
|
|
this._prompt.ui.button0.click();
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
2020-06-03 02:51:13 +03:00
|
|
|
function dirPath(path) {
|
|
|
|
return path.substring(0, path.lastIndexOf('/') + 1);
|
|
|
|
}
|
|
|
|
|
2020-06-10 08:48:10 +03:00
|
|
|
async function waitForWindowReady(window) {
|
|
|
|
if (window.delayedStartupPromise) {
|
|
|
|
await window.delayedStartupPromise;
|
|
|
|
} else {
|
|
|
|
await new Promise((resolve => {
|
|
|
|
Services.obs.addObserver(function observer(aSubject, aTopic) {
|
|
|
|
if (window == aSubject) {
|
|
|
|
Services.obs.removeObserver(observer, aTopic);
|
|
|
|
resolve();
|
|
|
|
}
|
|
|
|
}, "browser-delayed-startup-finished");
|
|
|
|
}));
|
|
|
|
}
|
2020-09-30 10:36:46 +03:00
|
|
|
if (window.document.readyState !== 'complete')
|
|
|
|
await helper.awaitEvent(window, 'load');
|
2020-06-10 08:48:10 +03:00
|
|
|
}
|
|
|
|
|
2020-10-02 14:13:42 +03:00
|
|
|
async function setViewportSizeForBrowser(viewportSize, browser, window) {
|
|
|
|
await waitForWindowReady(window);
|
2020-06-03 02:51:13 +03:00
|
|
|
if (viewportSize) {
|
|
|
|
const {width, height} = viewportSize;
|
2020-07-08 00:04:07 +03:00
|
|
|
const rect = browser.getBoundingClientRect();
|
|
|
|
window.resizeBy(width - rect.width, height - rect.height);
|
2020-06-03 02:51:13 +03:00
|
|
|
browser.style.setProperty('min-width', width + 'px');
|
|
|
|
browser.style.setProperty('min-height', height + 'px');
|
|
|
|
browser.style.setProperty('max-width', width + 'px');
|
|
|
|
browser.style.setProperty('max-height', height + 'px');
|
|
|
|
} else {
|
|
|
|
browser.style.removeProperty('min-width');
|
|
|
|
browser.style.removeProperty('min-height');
|
|
|
|
browser.style.removeProperty('max-width');
|
|
|
|
browser.style.removeProperty('max-height');
|
|
|
|
}
|
|
|
|
const rect = browser.getBoundingClientRect();
|
|
|
|
return { width: rect.width, height: rect.height };
|
|
|
|
}
|
|
|
|
|
|
|
|
TargetRegistry.Events = {
|
|
|
|
TargetCreated: Symbol('TargetRegistry.Events.TargetCreated'),
|
|
|
|
TargetDestroyed: Symbol('TargetRegistry.Events.TargetDestroyed'),
|
|
|
|
DownloadCreated: Symbol('TargetRegistry.Events.DownloadCreated'),
|
|
|
|
DownloadFinished: Symbol('TargetRegistry.Events.DownloadFinished'),
|
2021-05-08 04:05:26 +03:00
|
|
|
ScreencastStopped: Symbol('TargetRegistry.ScreencastStopped'),
|
2020-06-03 02:51:13 +03:00
|
|
|
};
|
|
|
|
|
2020-10-06 11:53:25 +03:00
|
|
|
var EXPORTED_SYMBOLS = ['TargetRegistry', 'PageTarget'];
|
2020-06-03 02:51:13 +03:00
|
|
|
this.TargetRegistry = TargetRegistry;
|
2020-10-06 11:53:25 +03:00
|
|
|
this.PageTarget = PageTarget;
|