Start work on creating gpui2 version of project panel (#3299)

I'm gonna land what I have, even though some features aren't ported yet,
since we're working on all of this code so actively.

* [x] get the basic structure compiling
* [x] get the panel laying out correctly
* [ ] rename / new file editor
* [ ] enable the tests
* [ ] drag and drop
* [ ] context menu
This commit is contained in:
Max Brunsfeld 2023-11-14 09:56:46 -08:00 committed by GitHub
commit c7d80c7aac
No known key found for this signature in database
GPG Key ID: 4AEE18F83AFDEB23
13 changed files with 646 additions and 552 deletions

31
Cargo.lock generated
View File

@ -6608,6 +6608,36 @@ dependencies = [
"workspace", "workspace",
] ]
[[package]]
name = "project_panel2"
version = "0.1.0"
dependencies = [
"anyhow",
"client2",
"collections",
"context_menu",
"db2",
"editor2",
"futures 0.3.28",
"gpui2",
"language2",
"menu2",
"postage",
"pretty_assertions",
"project2",
"schemars",
"serde",
"serde_derive",
"serde_json",
"settings2",
"smallvec",
"theme2",
"ui2",
"unicase",
"util",
"workspace2",
]
[[package]] [[package]]
name = "project_symbols" name = "project_symbols"
version = "0.1.0" version = "0.1.0"
@ -11417,6 +11447,7 @@ dependencies = [
"parking_lot 0.11.2", "parking_lot 0.11.2",
"postage", "postage",
"project2", "project2",
"project_panel2",
"rand 0.8.5", "rand 0.8.5",
"regex", "regex",
"rope2", "rope2",

View File

@ -80,6 +80,7 @@ members = [
"crates/project", "crates/project",
"crates/project2", "crates/project2",
"crates/project_panel", "crates/project_panel",
"crates/project_panel2",
"crates/project_symbols", "crates/project_symbols",
"crates/recent_projects", "crates/recent_projects",
"crates/rope", "crates/rope",

View File

@ -293,7 +293,16 @@ pub fn blue() -> Hsla {
pub fn green() -> Hsla { pub fn green() -> Hsla {
Hsla { Hsla {
h: 0.3, h: 0.33,
s: 1.,
l: 0.5,
a: 1.,
}
}
pub fn yellow() -> Hsla {
Hsla {
h: 0.16,
s: 1., s: 1.,
l: 0.5, l: 0.5,
a: 1., a: 1.,

View File

@ -0,0 +1,41 @@
[package]
name = "project_panel2"
version = "0.1.0"
edition = "2021"
publish = false
[lib]
path = "src/project_panel.rs"
doctest = false
[dependencies]
context_menu = { path = "../context_menu" }
collections = { path = "../collections" }
db = { path = "../db2", package = "db2" }
editor = { path = "../editor2", package = "editor2" }
gpui = { path = "../gpui2", package = "gpui2" }
menu = { path = "../menu2", package = "menu2" }
project = { path = "../project2", package = "project2" }
settings = { path = "../settings2", package = "settings2" }
theme = { path = "../theme2", package = "theme2" }
ui = { path = "../ui2", package = "ui2" }
util = { path = "../util" }
workspace = { path = "../workspace2", package = "workspace2" }
anyhow.workspace = true
postage.workspace = true
futures.workspace = true
serde.workspace = true
serde_derive.workspace = true
serde_json.workspace = true
schemars.workspace = true
smallvec.workspace = true
pretty_assertions.workspace = true
unicase = "2.6"
[dev-dependencies]
client = { path = "../client2", package = "client2", features = ["test-support"] }
language = { path = "../language2", package = "language2", features = ["test-support"] }
editor = { path = "../editor2", package = "editor2", features = ["test-support"] }
gpui = { path = "../gpui2", package = "gpui2", features = ["test-support"] }
workspace = { path = "../workspace2", package = "workspace2", features = ["test-support"] }
serde_json.workspace = true

View File

@ -0,0 +1,96 @@
use std::{path::Path, str, sync::Arc};
use collections::HashMap;
use gpui::{AppContext, AssetSource};
use serde_derive::Deserialize;
use util::{maybe, paths::PathExt};
#[derive(Deserialize, Debug)]
struct TypeConfig {
icon: Arc<str>,
}
#[derive(Deserialize, Debug)]
pub struct FileAssociations {
suffixes: HashMap<String, String>,
types: HashMap<String, TypeConfig>,
}
const COLLAPSED_DIRECTORY_TYPE: &'static str = "collapsed_folder";
const EXPANDED_DIRECTORY_TYPE: &'static str = "expanded_folder";
const COLLAPSED_CHEVRON_TYPE: &'static str = "collapsed_chevron";
const EXPANDED_CHEVRON_TYPE: &'static str = "expanded_chevron";
pub const FILE_TYPES_ASSET: &'static str = "icons/file_icons/file_types.json";
pub fn init(assets: impl AssetSource, cx: &mut AppContext) {
cx.set_global(FileAssociations::new(assets))
}
impl FileAssociations {
pub fn new(assets: impl AssetSource) -> Self {
assets
.load("icons/file_icons/file_types.json")
.and_then(|file| {
serde_json::from_str::<FileAssociations>(str::from_utf8(&file).unwrap())
.map_err(Into::into)
})
.unwrap_or_else(|_| FileAssociations {
suffixes: HashMap::default(),
types: HashMap::default(),
})
}
pub fn get_icon(path: &Path, cx: &AppContext) -> Arc<str> {
maybe!({
let this = cx.has_global::<Self>().then(|| cx.global::<Self>())?;
// FIXME: Associate a type with the languages and have the file's langauge
// override these associations
maybe!({
let suffix = path.icon_suffix()?;
this.suffixes
.get(suffix)
.and_then(|type_str| this.types.get(type_str))
.map(|type_config| type_config.icon.clone())
})
.or_else(|| this.types.get("default").map(|config| config.icon.clone()))
})
.unwrap_or_else(|| Arc::from("".to_string()))
}
pub fn get_folder_icon(expanded: bool, cx: &AppContext) -> Arc<str> {
maybe!({
let this = cx.has_global::<Self>().then(|| cx.global::<Self>())?;
let key = if expanded {
EXPANDED_DIRECTORY_TYPE
} else {
COLLAPSED_DIRECTORY_TYPE
};
this.types
.get(key)
.map(|type_config| type_config.icon.clone())
})
.unwrap_or_else(|| Arc::from("".to_string()))
}
pub fn get_chevron_icon(expanded: bool, cx: &AppContext) -> Arc<str> {
maybe!({
let this = cx.has_global::<Self>().then(|| cx.global::<Self>())?;
let key = if expanded {
EXPANDED_CHEVRON_TYPE
} else {
COLLAPSED_CHEVRON_TYPE
};
this.types
.get(key)
.map(|type_config| type_config.icon.clone())
})
.unwrap_or_else(|| Arc::from("".to_string()))
}
}

View File

@ -8,10 +8,10 @@ use file_associations::FileAssociations;
use anyhow::{anyhow, Result}; use anyhow::{anyhow, Result};
use gpui::{ use gpui::{
actions, div, px, svg, uniform_list, Action, AppContext, AssetSource, AsyncAppContext, actions, div, px, rems, svg, uniform_list, Action, AppContext, AssetSource, AsyncWindowContext,
AsyncWindowContext, ClipboardItem, Div, Element, Entity, EventEmitter, FocusEnabled, ClipboardItem, Component, Div, EventEmitter, FocusHandle, FocusableKeyDispatch, Model,
FocusHandle, Model, ParentElement as _, Pixels, Point, PromptLevel, Render, MouseButton, ParentElement as _, Pixels, Point, PromptLevel, Render, StatefulInteractive,
StatefulInteractive, StatefulInteractivity, Styled, Task, UniformListScrollHandle, View, StatefulInteractivity, StatelessInteractive, Styled, Task, UniformListScrollHandle, View,
ViewContext, VisualContext as _, WeakView, WindowContext, ViewContext, VisualContext as _, WeakView, WindowContext,
}; };
use menu::{Confirm, SelectNext, SelectPrev}; use menu::{Confirm, SelectNext, SelectPrev};
@ -31,9 +31,9 @@ use std::{
sync::Arc, sync::Arc,
}; };
use theme::ActiveTheme as _; use theme::ActiveTheme as _;
use ui::{h_stack, v_stack}; use ui::{h_stack, v_stack, Label};
use unicase::UniCase; use unicase::UniCase;
use util::TryFutureExt; use util::{maybe, TryFutureExt};
use workspace::{ use workspace::{
dock::{DockPosition, PanelEvent}, dock::{DockPosition, PanelEvent},
Workspace, Workspace,
@ -54,8 +54,8 @@ pub struct ProjectPanel {
edit_state: Option<EditState>, edit_state: Option<EditState>,
filename_editor: View<Editor>, filename_editor: View<Editor>,
clipboard_entry: Option<ClipboardEntry>, clipboard_entry: Option<ClipboardEntry>,
dragged_entry_destination: Option<Arc<Path>>, _dragged_entry_destination: Option<Arc<Path>>,
workspace: WeakView<Workspace>, _workspace: WeakView<Workspace>,
has_focus: bool, has_focus: bool,
width: Option<f32>, width: Option<f32>,
pending_serialization: Task<Option<()>>, pending_serialization: Task<Option<()>>,
@ -131,31 +131,6 @@ pub fn init_settings(cx: &mut AppContext) {
pub fn init(assets: impl AssetSource, cx: &mut AppContext) { pub fn init(assets: impl AssetSource, cx: &mut AppContext) {
init_settings(cx); init_settings(cx);
file_associations::init(assets, cx); file_associations::init(assets, cx);
// cx.add_action(ProjectPanel::expand_selected_entry);
// cx.add_action(ProjectPanel::collapse_selected_entry);
// cx.add_action(ProjectPanel::collapse_all_entries);
// cx.add_action(ProjectPanel::select_prev);
// cx.add_action(ProjectPanel::select_next);
// cx.add_action(ProjectPanel::new_file);
// cx.add_action(ProjectPanel::new_directory);
// cx.add_action(ProjectPanel::rename);
// cx.add_async_action(ProjectPanel::delete);
// cx.add_async_action(ProjectPanel::confirm);
// cx.add_async_action(ProjectPanel::open_file);
// cx.add_action(ProjectPanel::cancel);
// cx.add_action(ProjectPanel::cut);
// cx.add_action(ProjectPanel::copy);
// cx.add_action(ProjectPanel::copy_path);
// cx.add_action(ProjectPanel::copy_relative_path);
// cx.add_action(ProjectPanel::reveal_in_finder);
// cx.add_action(ProjectPanel::open_in_terminal);
// cx.add_action(ProjectPanel::new_search_in_directory);
// cx.add_action(
// |this: &mut ProjectPanel, action: &Paste, cx: &mut ViewContext<ProjectPanel>| {
// this.paste(action, cx);
// },
// );
} }
#[derive(Debug)] #[derive(Debug)]
@ -244,7 +219,6 @@ impl ProjectPanel {
// }) // })
// .detach(); // .detach();
let view_id = cx.view().entity_id();
let mut this = Self { let mut this = Self {
project: project.clone(), project: project.clone(),
fs: workspace.app_state().fs.clone(), fs: workspace.app_state().fs.clone(),
@ -258,8 +232,8 @@ impl ProjectPanel {
filename_editor, filename_editor,
clipboard_entry: None, clipboard_entry: None,
// context_menu: cx.add_view(|cx| ContextMenu::new(view_id, cx)), // context_menu: cx.add_view(|cx| ContextMenu::new(view_id, cx)),
dragged_entry_destination: None, _dragged_entry_destination: None,
workspace: workspace.weak_handle(), _workspace: workspace.weak_handle(),
has_focus: false, has_focus: false,
width: None, width: None,
pending_serialization: Task::ready(None), pending_serialization: Task::ready(None),
@ -311,8 +285,8 @@ impl ProjectPanel {
} }
} }
&Event::SplitEntry { entry_id } => { &Event::SplitEntry { entry_id } => {
// if let Some(worktree) = project.read(cx).worktree_for_entry(entry_id, cx) { if let Some(worktree) = project.read(cx).worktree_for_entry(entry_id, cx) {
// if let Some(entry) = worktree.read(cx).entry_for_id(entry_id) { if let Some(_entry) = worktree.read(cx).entry_for_id(entry_id) {
// workspace // workspace
// .split_path( // .split_path(
// ProjectPath { // ProjectPath {
@ -322,8 +296,8 @@ impl ProjectPanel {
// cx, // cx,
// ) // )
// .detach_and_log_err(cx); // .detach_and_log_err(cx);
// } }
// } }
} }
_ => {} _ => {}
} }
@ -391,10 +365,11 @@ impl ProjectPanel {
fn deploy_context_menu( fn deploy_context_menu(
&mut self, &mut self,
position: Point<Pixels>, _position: Point<Pixels>,
entry_id: ProjectEntryId, _entry_id: ProjectEntryId,
cx: &mut ViewContext<Self>, _cx: &mut ViewContext<Self>,
) { ) {
todo!()
// let project = self.project.read(cx); // let project = self.project.read(cx);
// let worktree_id = if let Some(id) = project.worktree_id_for_entry(entry_id, cx) { // let worktree_id = if let Some(id) = project.worktree_id_for_entry(entry_id, cx) {
@ -579,22 +554,18 @@ impl ProjectPanel {
} }
} }
fn confirm(&mut self, _: &Confirm, cx: &mut ViewContext<Self>) -> Option<Task<Result<()>>> { fn confirm(&mut self, _: &Confirm, cx: &mut ViewContext<Self>) {
if let Some(task) = self.confirm_edit(cx) { if let Some(task) = self.confirm_edit(cx) {
return Some(task); task.detach_and_log_err(cx);
}
} }
None fn open_file(&mut self, _: &Open, cx: &mut ViewContext<Self>) {
}
fn open_file(&mut self, _: &Open, cx: &mut ViewContext<Self>) -> Option<Task<Result<()>>> {
if let Some((_, entry)) = self.selected_entry(cx) { if let Some((_, entry)) = self.selected_entry(cx) {
if entry.is_file() { if entry.is_file() {
self.open_entry(entry.id, true, cx); self.open_entry(entry.id, true, cx);
} }
} }
None
} }
fn confirm_edit(&mut self, cx: &mut ViewContext<Self>) -> Option<Task<Result<()>>> { fn confirm_edit(&mut self, cx: &mut ViewContext<Self>) -> Option<Task<Result<()>>> {
@ -800,17 +771,19 @@ impl ProjectPanel {
} }
} }
fn delete(&mut self, _: &Delete, cx: &mut ViewContext<Self>) -> Option<Task<Result<()>>> { fn delete(&mut self, _: &Delete, cx: &mut ViewContext<Self>) {
maybe!({
let Selection { entry_id, .. } = self.selection?; let Selection { entry_id, .. } = self.selection?;
let path = self.project.read(cx).path_for_entry(entry_id, cx)?.path; let path = self.project.read(cx).path_for_entry(entry_id, cx)?.path;
let file_name = path.file_name()?; let file_name = path.file_name()?;
let mut answer = cx.prompt( let answer = cx.prompt(
PromptLevel::Info, PromptLevel::Info,
&format!("Delete {file_name:?}?"), &format!("Delete {file_name:?}?"),
&["Delete", "Cancel"], &["Delete", "Cancel"],
); );
Some(cx.spawn(|this, mut cx| async move {
cx.spawn(|this, mut cx| async move {
if answer.await != Ok(0) { if answer.await != Ok(0) {
return Ok(()); return Ok(());
} }
@ -820,7 +793,10 @@ impl ProjectPanel {
.ok_or_else(|| anyhow!("no such entry")) .ok_or_else(|| anyhow!("no such entry"))
})?? })??
.await .await
})) })
.detach_and_log_err(cx);
Some(())
});
} }
fn select_next(&mut self, _: &SelectNext, cx: &mut ViewContext<Self>) { fn select_next(&mut self, _: &SelectNext, cx: &mut ViewContext<Self>) {
@ -897,8 +873,9 @@ impl ProjectPanel {
} }
} }
fn paste(&mut self, _: &Paste, cx: &mut ViewContext<Self>) -> Option<()> { fn paste(&mut self, _: &Paste, cx: &mut ViewContext<Self>) {
if let Some((worktree, entry)) = self.selected_entry(cx) { maybe!({
let (worktree, entry) = self.selected_entry(cx)?;
let clipboard_entry = self.clipboard_entry?; let clipboard_entry = self.clipboard_entry?;
if clipboard_entry.worktree_id() != worktree.id() { if clipboard_entry.worktree_id() != worktree.id() {
return None; return None;
@ -942,15 +919,16 @@ impl ProjectPanel {
if let Some(task) = self.project.update(cx, |project, cx| { if let Some(task) = self.project.update(cx, |project, cx| {
project.rename_entry(clipboard_entry.entry_id(), new_path, cx) project.rename_entry(clipboard_entry.entry_id(), new_path, cx)
}) { }) {
task.detach_and_log_err(cx) task.detach_and_log_err(cx);
} }
} else if let Some(task) = self.project.update(cx, |project, cx| { } else if let Some(task) = self.project.update(cx, |project, cx| {
project.copy_entry(clipboard_entry.entry_id(), new_path, cx) project.copy_entry(clipboard_entry.entry_id(), new_path, cx)
}) { }) {
task.detach_and_log_err(cx) task.detach_and_log_err(cx);
} }
}
None Some(())
});
} }
fn copy_path(&mut self, _: &CopyPath, cx: &mut ViewContext<Self>) { fn copy_path(&mut self, _: &CopyPath, cx: &mut ViewContext<Self>) {
@ -977,7 +955,7 @@ impl ProjectPanel {
} }
} }
fn open_in_terminal(&mut self, _: &OpenInTerminal, cx: &mut ViewContext<Self>) { fn open_in_terminal(&mut self, _: &OpenInTerminal, _cx: &mut ViewContext<Self>) {
todo!() todo!()
// if let Some((worktree, entry)) = self.selected_entry(cx) { // if let Some((worktree, entry)) = self.selected_entry(cx) {
// let window = cx.window(); // let window = cx.window();
@ -1012,36 +990,37 @@ impl ProjectPanel {
} }
} }
fn move_entry( // todo!()
&mut self, // fn move_entry(
entry_to_move: ProjectEntryId, // &mut self,
destination: ProjectEntryId, // entry_to_move: ProjectEntryId,
destination_is_file: bool, // destination: ProjectEntryId,
cx: &mut ViewContext<Self>, // destination_is_file: bool,
) { // cx: &mut ViewContext<Self>,
let destination_worktree = self.project.update(cx, |project, cx| { // ) {
let entry_path = project.path_for_entry(entry_to_move, cx)?; // let destination_worktree = self.project.update(cx, |project, cx| {
let destination_entry_path = project.path_for_entry(destination, cx)?.path.clone(); // let entry_path = project.path_for_entry(entry_to_move, cx)?;
// let destination_entry_path = project.path_for_entry(destination, cx)?.path.clone();
let mut destination_path = destination_entry_path.as_ref(); // let mut destination_path = destination_entry_path.as_ref();
if destination_is_file { // if destination_is_file {
destination_path = destination_path.parent()?; // destination_path = destination_path.parent()?;
} // }
let mut new_path = destination_path.to_path_buf(); // let mut new_path = destination_path.to_path_buf();
new_path.push(entry_path.path.file_name()?); // new_path.push(entry_path.path.file_name()?);
if new_path != entry_path.path.as_ref() { // if new_path != entry_path.path.as_ref() {
let task = project.rename_entry(entry_to_move, new_path, cx)?; // let task = project.rename_entry(entry_to_move, new_path, cx)?;
cx.foreground_executor().spawn(task).detach_and_log_err(cx); // cx.foreground_executor().spawn(task).detach_and_log_err(cx);
} // }
Some(project.worktree_id_for_entry(destination, cx)?) // Some(project.worktree_id_for_entry(destination, cx)?)
}); // });
if let Some(destination_worktree) = destination_worktree { // if let Some(destination_worktree) = destination_worktree {
self.expand_entry(destination_worktree, destination, cx); // self.expand_entry(destination_worktree, destination, cx);
} // }
} // }
fn index_for_selection(&self, selection: Selection) -> Option<(usize, usize, usize)> { fn index_for_selection(&self, selection: Selection) -> Option<(usize, usize, usize)> {
let mut entry_index = 0; let mut entry_index = 0;
@ -1366,23 +1345,32 @@ impl ProjectPanel {
.git_status .git_status
.as_ref() .as_ref()
.map(|status| match status { .map(|status| match status {
GitFileStatus::Added => theme.styles.status.created, GitFileStatus::Added => theme.status().created,
GitFileStatus::Modified => theme.styles.status.modified, GitFileStatus::Modified => theme.status().modified,
GitFileStatus::Conflict => theme.styles.status.conflict, GitFileStatus::Conflict => theme.status().conflict,
}) })
.unwrap_or(theme.styles.status.info); .unwrap_or(theme.status().info);
h_stack() h_stack()
.child(if let Some(icon) = &details.icon { .child(if let Some(icon) = &details.icon {
div().child(svg().path(icon.to_string())) div().child(
// todo!() Marshall: Can we use our `IconElement` component here?
svg()
.size(rems(0.9375))
.flex_none()
.path(icon.to_string())
.text_color(cx.theme().colors().icon),
)
} else { } else {
div() div()
}) })
.child( .child(
if let (Some(editor), true) = (editor, show_editor) { if let (Some(editor), true) = (editor, show_editor) {
div().child(editor.clone()) div().w_full().child(editor.clone())
} else { } else {
div().child(details.filename.clone()) div()
.text_color(filename_text_color)
.child(Label::new(details.filename.clone()))
} }
.ml_1(), .ml_1(),
) )
@ -1390,11 +1378,10 @@ impl ProjectPanel {
} }
fn render_entry( fn render_entry(
&self,
entry_id: ProjectEntryId, entry_id: ProjectEntryId,
details: EntryDetails, details: EntryDetails,
editor: &View<Editor>,
// dragged_entry_destination: &mut Option<Arc<Path>>, // dragged_entry_destination: &mut Option<Arc<Path>>,
// theme: &theme::ProjectPanel,
cx: &mut ViewContext<Self>, cx: &mut ViewContext<Self>,
) -> Div<Self, StatefulInteractivity<Self>> { ) -> Div<Self, StatefulInteractivity<Self>> {
let kind = details.kind; let kind = details.kind;
@ -1402,9 +1389,18 @@ impl ProjectPanel {
const INDENT_SIZE: Pixels = px(16.0); const INDENT_SIZE: Pixels = px(16.0);
let padding = INDENT_SIZE + details.depth as f32 * px(settings.indent_size); let padding = INDENT_SIZE + details.depth as f32 * px(settings.indent_size);
let show_editor = details.is_editing && !details.is_processing; let show_editor = details.is_editing && !details.is_processing;
let is_selected = self
.selection
.map_or(false, |selection| selection.entry_id == entry_id);
Self::render_entry_visual_element(&details, Some(editor), padding, cx) Self::render_entry_visual_element(&details, Some(&self.filename_editor), padding, cx)
.id(entry_id.to_proto() as usize) .id(entry_id.to_proto() as usize)
.w_full()
.cursor_pointer()
.when(is_selected, |this| {
this.bg(cx.theme().colors().element_selected)
})
.hover(|style| style.bg(cx.theme().colors().element_hover))
.on_click(move |this, event, cx| { .on_click(move |this, event, cx| {
if !show_editor { if !show_editor {
if kind.is_dir() { if kind.is_dir() {
@ -1418,38 +1414,51 @@ impl ProjectPanel {
} }
} }
}) })
// .on_down(MouseButton::Right, move |event, this, cx| { .on_mouse_down(MouseButton::Right, move |this, event, cx| {
// this.deploy_context_menu(event.position, entry_id, cx); this.deploy_context_menu(event.position, entry_id, cx);
// }) })
// .on_up(MouseButton::Left, move |_, this, cx| { // .on_drop::<ProjectEntryId>(|this, event, cx| {
// if let Some((_, dragged_entry)) = cx
// .global::<DragAndDrop<Workspace>>()
// .currently_dragged::<ProjectEntryId>(cx.window())
// {
// this.move_entry( // this.move_entry(
// *dragged_entry, // *dragged_entry,
// entry_id, // entry_id,
// matches!(details.kind, EntryKind::File(_)), // matches!(details.kind, EntryKind::File(_)),
// cx, // cx,
// ); // );
// }
// }) // })
} }
} }
impl Render for ProjectPanel { impl Render for ProjectPanel {
type Element = Div<Self, StatefulInteractivity<Self>, FocusEnabled<Self>>; type Element = Div<Self, StatefulInteractivity<Self>, FocusableKeyDispatch<Self>>;
fn render(&mut self, cx: &mut gpui::ViewContext<Self>) -> Self::Element {
enum ProjectPanel {}
let theme = cx.theme();
let last_worktree_root_id = self.last_worktree_root_id;
fn render(&mut self, _cx: &mut gpui::ViewContext<Self>) -> Self::Element {
let has_worktree = self.visible_entries.len() != 0; let has_worktree = self.visible_entries.len() != 0;
if has_worktree { if has_worktree {
div() div()
.id("project-panel") .id("project-panel")
.size_full()
.context("ProjectPanel")
.on_action(Self::select_next)
.on_action(Self::select_prev)
.on_action(Self::expand_selected_entry)
.on_action(Self::collapse_selected_entry)
.on_action(Self::collapse_all_entries)
.on_action(Self::new_file)
.on_action(Self::new_directory)
.on_action(Self::rename)
.on_action(Self::delete)
.on_action(Self::confirm)
.on_action(Self::open_file)
.on_action(Self::cancel)
.on_action(Self::cut)
.on_action(Self::copy)
.on_action(Self::copy_path)
.on_action(Self::copy_relative_path)
.on_action(Self::paste)
.on_action(Self::reveal_in_finder)
.on_action(Self::open_in_terminal)
.on_action(Self::new_search_in_directory)
.track_focus(&self.focus_handle) .track_focus(&self.focus_handle)
.child( .child(
uniform_list( uniform_list(
@ -1461,17 +1470,12 @@ impl Render for ProjectPanel {
|this: &mut Self, range, cx| { |this: &mut Self, range, cx| {
let mut items = SmallVec::new(); let mut items = SmallVec::new();
this.for_each_visible_entry(range, cx, |id, details, cx| { this.for_each_visible_entry(range, cx, |id, details, cx| {
items.push(Self::render_entry( items.push(this.render_entry(id, details, cx));
id,
details,
&this.filename_editor,
// &mut dragged_entry_destination,
cx,
));
}); });
items items
}, },
) )
.size_full()
.track_scroll(self.list.clone()), .track_scroll(self.list.clone()),
) )
} else { } else {

View File

@ -0,0 +1,45 @@
use anyhow;
use schemars::JsonSchema;
use serde_derive::{Deserialize, Serialize};
use settings::Settings;
#[derive(Clone, Debug, Serialize, Deserialize, JsonSchema)]
#[serde(rename_all = "snake_case")]
pub enum ProjectPanelDockPosition {
Left,
Right,
}
#[derive(Deserialize, Debug)]
pub struct ProjectPanelSettings {
pub default_width: f32,
pub dock: ProjectPanelDockPosition,
pub file_icons: bool,
pub folder_icons: bool,
pub git_status: bool,
pub indent_size: f32,
}
#[derive(Clone, Default, Serialize, Deserialize, JsonSchema, Debug)]
pub struct ProjectPanelSettingsContent {
pub default_width: Option<f32>,
pub dock: Option<ProjectPanelDockPosition>,
pub file_icons: Option<bool>,
pub folder_icons: Option<bool>,
pub git_status: Option<bool>,
pub indent_size: Option<f32>,
}
impl Settings for ProjectPanelSettings {
const KEY: Option<&'static str> = Some("project_panel");
type FileContent = ProjectPanelSettingsContent;
fn load(
default_value: &Self::FileContent,
user_values: &[&Self::FileContent],
_: &mut gpui::AppContext,
) -> anyhow::Result<Self> {
Self::load_via_json_merge(default_value, user_values)
}
}

View File

@ -9,7 +9,7 @@ use schemars::{
}; };
use serde::Deserialize; use serde::Deserialize;
use serde_json::Value; use serde_json::Value;
use util::{asset_str, ResultExt}; use util::asset_str;
#[derive(Debug, Deserialize, Default, Clone, JsonSchema)] #[derive(Debug, Deserialize, Default, Clone, JsonSchema)]
#[serde(transparent)] #[serde(transparent)]
@ -86,7 +86,9 @@ impl KeymapFile {
"invalid binding value for keystroke {keystroke}, context {context:?}" "invalid binding value for keystroke {keystroke}, context {context:?}"
) )
}) })
.log_err() // todo!()
.ok()
// .log_err()
.map(|action| KeyBinding::load(&keystroke, action, context.as_deref())) .map(|action| KeyBinding::load(&keystroke, action, context.as_deref()))
}) })
.collect::<Result<Vec<_>>>()?; .collect::<Result<Vec<_>>>()?;

View File

@ -1,7 +1,7 @@
use crate::{status_bar::StatusItemView, Axis, Workspace}; use crate::{status_bar::StatusItemView, Axis, Workspace};
use gpui::{ use gpui::{
div, Action, AnyView, AppContext, Div, Entity, EntityId, EventEmitter, ParentElement, Render, div, Action, AnyView, AppContext, Div, Entity, EntityId, EventEmitter, FocusHandle,
Subscription, View, ViewContext, WeakView, WindowContext, ParentElement, Render, Styled, Subscription, View, ViewContext, WeakView, WindowContext,
}; };
use schemars::JsonSchema; use schemars::JsonSchema;
use serde::{Deserialize, Serialize}; use serde::{Deserialize, Serialize};
@ -34,6 +34,7 @@ pub trait Panel: Render + EventEmitter<PanelEvent> {
fn set_zoomed(&mut self, _zoomed: bool, _cx: &mut ViewContext<Self>) {} fn set_zoomed(&mut self, _zoomed: bool, _cx: &mut ViewContext<Self>) {}
fn set_active(&mut self, _active: bool, _cx: &mut ViewContext<Self>) {} fn set_active(&mut self, _active: bool, _cx: &mut ViewContext<Self>) {}
fn has_focus(&self, cx: &WindowContext) -> bool; fn has_focus(&self, cx: &WindowContext) -> bool;
fn focus_handle(&self, cx: &WindowContext) -> FocusHandle;
} }
pub trait PanelHandle: Send + Sync { pub trait PanelHandle: Send + Sync {
@ -51,6 +52,7 @@ pub trait PanelHandle: Send + Sync {
fn icon_tooltip(&self, cx: &WindowContext) -> (String, Option<Box<dyn Action>>); fn icon_tooltip(&self, cx: &WindowContext) -> (String, Option<Box<dyn Action>>);
fn icon_label(&self, cx: &WindowContext) -> Option<String>; fn icon_label(&self, cx: &WindowContext) -> Option<String>;
fn has_focus(&self, cx: &WindowContext) -> bool; fn has_focus(&self, cx: &WindowContext) -> bool;
fn focus_handle(&self, cx: &WindowContext) -> FocusHandle;
fn to_any(&self) -> AnyView; fn to_any(&self) -> AnyView;
} }
@ -117,6 +119,10 @@ where
fn to_any(&self) -> AnyView { fn to_any(&self) -> AnyView {
self.clone().into() self.clone().into()
} }
fn focus_handle(&self, cx: &WindowContext) -> FocusHandle {
self.read(cx).focus_handle(cx).clone()
}
} }
impl From<&dyn PanelHandle> for AnyView { impl From<&dyn PanelHandle> for AnyView {
@ -422,7 +428,11 @@ impl Render for Dock {
type Element = Div<Self>; type Element = Div<Self>;
fn render(&mut self, cx: &mut ViewContext<Self>) -> Self::Element { fn render(&mut self, cx: &mut ViewContext<Self>) -> Self::Element {
todo!() if let Some(entry) = self.visible_entry() {
div().size_full().child(entry.panel.to_any())
} else {
div()
}
} }
} }
@ -728,5 +738,9 @@ pub mod test {
fn has_focus(&self, _cx: &WindowContext) -> bool { fn has_focus(&self, _cx: &WindowContext) -> bool {
self.has_focus self.has_focus
} }
fn focus_handle(&self, cx: &WindowContext) -> FocusHandle {
unimplemented!()
}
} }
} }

View File

@ -29,7 +29,7 @@ use client2::{
Client, TypedEnvelope, UserStore, Client, TypedEnvelope, UserStore,
}; };
use collections::{hash_map, HashMap, HashSet}; use collections::{hash_map, HashMap, HashSet};
use dock::{Dock, DockPosition, PanelButtons}; use dock::{Dock, DockPosition, Panel, PanelButtons, PanelHandle as _};
use futures::{ use futures::{
channel::{mpsc, oneshot}, channel::{mpsc, oneshot},
future::try_join_all, future::try_join_all,
@ -248,102 +248,6 @@ pub fn init(app_state: Arc<AppState>, cx: &mut AppContext) {
// } // }
// } // }
// }); // });
// cx.add_async_action(Workspace::open);
// cx.add_async_action(Workspace::follow_next_collaborator);
// cx.add_async_action(Workspace::close);
// cx.add_async_action(Workspace::close_inactive_items_and_panes);
// cx.add_async_action(Workspace::close_all_items_and_panes);
// cx.add_global_action(Workspace::close_global);
// cx.add_global_action(restart);
// cx.add_async_action(Workspace::save_all);
// cx.add_action(Workspace::add_folder_to_project);
// cx.add_action(
// |workspace: &mut Workspace, _: &Unfollow, cx: &mut ViewContext<Workspace>| {
// let pane = workspace.active_pane().clone();
// workspace.unfollow(&pane, cx);
// },
// );
// cx.add_action(
// |workspace: &mut Workspace, action: &Save, cx: &mut ViewContext<Workspace>| {
// workspace
// .save_active_item(action.save_intent.unwrap_or(SaveIntent::Save), cx)
// .detach_and_log_err(cx);
// },
// );
// cx.add_action(
// |workspace: &mut Workspace, _: &SaveAs, cx: &mut ViewContext<Workspace>| {
// workspace
// .save_active_item(SaveIntent::SaveAs, cx)
// .detach_and_log_err(cx);
// },
// );
// cx.add_action(|workspace: &mut Workspace, _: &ActivatePreviousPane, cx| {
// workspace.activate_previous_pane(cx)
// });
// cx.add_action(|workspace: &mut Workspace, _: &ActivateNextPane, cx| {
// workspace.activate_next_pane(cx)
// });
// cx.add_action(
// |workspace: &mut Workspace, action: &ActivatePaneInDirection, cx| {
// workspace.activate_pane_in_direction(action.0, cx)
// },
// );
// cx.add_action(
// |workspace: &mut Workspace, action: &SwapPaneInDirection, cx| {
// workspace.swap_pane_in_direction(action.0, cx)
// },
// );
// cx.add_action(|workspace: &mut Workspace, _: &ToggleLeftDock, cx| {
// workspace.toggle_dock(DockPosition::Left, cx);
// });
// cx.add_action(|workspace: &mut Workspace, _: &ToggleRightDock, cx| {
// workspace.toggle_dock(DockPosition::Right, cx);
// });
// cx.add_action(|workspace: &mut Workspace, _: &ToggleBottomDock, cx| {
// workspace.toggle_dock(DockPosition::Bottom, cx);
// });
// cx.add_action(|workspace: &mut Workspace, _: &CloseAllDocks, cx| {
// workspace.close_all_docks(cx);
// });
// cx.add_action(Workspace::activate_pane_at_index);
// cx.add_action(|workspace: &mut Workspace, _: &ReopenClosedItem, cx| {
// workspace.reopen_closed_item(cx).detach();
// });
// cx.add_action(|workspace: &mut Workspace, _: &GoBack, cx| {
// workspace
// .go_back(workspace.active_pane().downgrade(), cx)
// .detach();
// });
// cx.add_action(|workspace: &mut Workspace, _: &GoForward, cx| {
// workspace
// .go_forward(workspace.active_pane().downgrade(), cx)
// .detach();
// });
// cx.add_action(|_: &mut Workspace, _: &install_cli::Install, cx| {
// cx.spawn(|workspace, mut cx| async move {
// let err = install_cli::install_cli(&cx)
// .await
// .context("Failed to create CLI symlink");
// workspace.update(&mut cx, |workspace, cx| {
// if matches!(err, Err(_)) {
// err.notify_err(workspace, cx);
// } else {
// workspace.show_notification(1, cx, |cx| {
// cx.build_view(|_| {
// MessageNotification::new("Successfully installed the `zed` binary")
// })
// });
// }
// })
// })
// .detach();
// });
} }
type ProjectItemBuilders = type ProjectItemBuilders =
@ -942,108 +846,15 @@ impl Workspace {
&self.right_dock &self.right_dock
} }
// pub fn add_panel<T: Panel>(&mut self, panel: View<T>, cx: &mut ViewContext<Self>) pub fn add_panel<T: Panel>(&mut self, panel: View<T>, cx: &mut ViewContext<Self>) {
// where let dock = match panel.position(cx) {
// T::Event: std::fmt::Debug, DockPosition::Left => &self.left_dock,
// { DockPosition::Bottom => &self.bottom_dock,
// self.add_panel_with_extra_event_handler(panel, cx, |_, _, _, _| {}) DockPosition::Right => &self.right_dock,
// } };
// pub fn add_panel_with_extra_event_handler<T: Panel, F>( dock.update(cx, |dock, cx| dock.add_panel(panel, cx));
// &mut self, }
// panel: View<T>,
// cx: &mut ViewContext<Self>,
// handler: F,
// ) where
// T::Event: std::fmt::Debug,
// F: Fn(&mut Self, &View<T>, &T::Event, &mut ViewContext<Self>) + 'static,
// {
// let dock = match panel.position(cx) {
// DockPosition::Left => &self.left_dock,
// DockPosition::Bottom => &self.bottom_dock,
// DockPosition::Right => &self.right_dock,
// };
// self.subscriptions.push(cx.subscribe(&panel, {
// let mut dock = dock.clone();
// let mut prev_position = panel.position(cx);
// move |this, panel, event, cx| {
// if T::should_change_position_on_event(event) {
// THIS HAS BEEN MOVED TO NORMAL EVENT EMISSION
// See: Dock::add_panel
//
// let new_position = panel.read(cx).position(cx);
// let mut was_visible = false;
// dock.update(cx, |dock, cx| {
// prev_position = new_position;
// was_visible = dock.is_open()
// && dock
// .visible_panel()
// .map_or(false, |active_panel| active_panel.id() == panel.id());
// dock.remove_panel(&panel, cx);
// });
// if panel.is_zoomed(cx) {
// this.zoomed_position = Some(new_position);
// }
// dock = match panel.read(cx).position(cx) {
// DockPosition::Left => &this.left_dock,
// DockPosition::Bottom => &this.bottom_dock,
// DockPosition::Right => &this.right_dock,
// }
// .clone();
// dock.update(cx, |dock, cx| {
// dock.add_panel(panel.clone(), cx);
// if was_visible {
// dock.set_open(true, cx);
// dock.activate_panel(dock.panels_len() - 1, cx);
// }
// });
// } else if T::should_zoom_in_on_event(event) {
// THIS HAS BEEN MOVED TO NORMAL EVENT EMISSION
// See: Dock::add_panel
//
// dock.update(cx, |dock, cx| dock.set_panel_zoomed(&panel, true, cx));
// if !panel.has_focus(cx) {
// cx.focus(&panel);
// }
// this.zoomed = Some(panel.downgrade().into_any());
// this.zoomed_position = Some(panel.read(cx).position(cx));
// } else if T::should_zoom_out_on_event(event) {
// THIS HAS BEEN MOVED TO NORMAL EVENT EMISSION
// See: Dock::add_panel
//
// dock.update(cx, |dock, cx| dock.set_panel_zoomed(&panel, false, cx));
// if this.zoomed_position == Some(prev_position) {
// this.zoomed = None;
// this.zoomed_position = None;
// }
// cx.notify();
// } else if T::is_focus_event(event) {
// THIS HAS BEEN MOVED TO NORMAL EVENT EMISSION
// See: Dock::add_panel
//
// let position = panel.read(cx).position(cx);
// this.dismiss_zoomed_items_to_reveal(Some(position), cx);
// if panel.is_zoomed(cx) {
// this.zoomed = Some(panel.downgrade().into_any());
// this.zoomed_position = Some(position);
// } else {
// this.zoomed = None;
// this.zoomed_position = None;
// }
// this.update_active_view_for_followers(cx);
// cx.notify();
// } else {
// handler(this, &panel, event, cx)
// }
// }
// }));
// dock.update(cx, |dock, cx| dock.add_panel(panel, cx));
// }
pub fn status_bar(&self) -> &View<StatusBar> { pub fn status_bar(&self) -> &View<StatusBar> {
&self.status_bar &self.status_bar
@ -1735,42 +1546,43 @@ impl Workspace {
// } // }
// } // }
// pub fn toggle_dock(&mut self, dock_side: DockPosition, cx: &mut ViewContext<Self>) { pub fn toggle_dock(&mut self, dock_side: DockPosition, cx: &mut ViewContext<Self>) {
// let dock = match dock_side { let dock = match dock_side {
// DockPosition::Left => &self.left_dock, DockPosition::Left => &self.left_dock,
// DockPosition::Bottom => &self.bottom_dock, DockPosition::Bottom => &self.bottom_dock,
// DockPosition::Right => &self.right_dock, DockPosition::Right => &self.right_dock,
// }; };
// let mut focus_center = false; let mut focus_center = false;
// let mut reveal_dock = false; let mut reveal_dock = false;
// dock.update(cx, |dock, cx| { dock.update(cx, |dock, cx| {
// let other_is_zoomed = self.zoomed.is_some() && self.zoomed_position != Some(dock_side); let other_is_zoomed = self.zoomed.is_some() && self.zoomed_position != Some(dock_side);
// let was_visible = dock.is_open() && !other_is_zoomed; let was_visible = dock.is_open() && !other_is_zoomed;
// dock.set_open(!was_visible, cx); dock.set_open(!was_visible, cx);
// if let Some(active_panel) = dock.active_panel() { if let Some(active_panel) = dock.active_panel() {
// if was_visible { if was_visible {
// if active_panel.has_focus(cx) { if active_panel.has_focus(cx) {
// focus_center = true; focus_center = true;
// } }
// } else { } else {
// cx.focus(active_panel.as_any()); let focus_handle = &active_panel.focus_handle(cx);
// reveal_dock = true; cx.focus(focus_handle);
// } reveal_dock = true;
// } }
// }); }
});
// if reveal_dock { if reveal_dock {
// self.dismiss_zoomed_items_to_reveal(Some(dock_side), cx); self.dismiss_zoomed_items_to_reveal(Some(dock_side), cx);
// } }
// if focus_center { if focus_center {
// cx.focus_self(); cx.focus(&self.focus_handle);
// } }
// cx.notify(); cx.notify();
// self.serialize_workspace(cx); self.serialize_workspace(cx);
// } }
pub fn close_all_docks(&mut self, cx: &mut ViewContext<Self>) { pub fn close_all_docks(&mut self, cx: &mut ViewContext<Self>) {
let docks = [&self.left_dock, &self.bottom_dock, &self.right_dock]; let docks = [&self.left_dock, &self.bottom_dock, &self.right_dock];
@ -3467,6 +3279,107 @@ impl Workspace {
}) })
} }
fn actions(div: Div<Self>) -> Div<Self> {
div
// cx.add_async_action(Workspace::open);
// cx.add_async_action(Workspace::follow_next_collaborator);
// cx.add_async_action(Workspace::close);
// cx.add_async_action(Workspace::close_inactive_items_and_panes);
// cx.add_async_action(Workspace::close_all_items_and_panes);
// cx.add_global_action(Workspace::close_global);
// cx.add_global_action(restart);
// cx.add_async_action(Workspace::save_all);
// cx.add_action(Workspace::add_folder_to_project);
// cx.add_action(
// |workspace: &mut Workspace, _: &Unfollow, cx: &mut ViewContext<Workspace>| {
// let pane = workspace.active_pane().clone();
// workspace.unfollow(&pane, cx);
// },
// );
// cx.add_action(
// |workspace: &mut Workspace, action: &Save, cx: &mut ViewContext<Workspace>| {
// workspace
// .save_active_item(action.save_intent.unwrap_or(SaveIntent::Save), cx)
// .detach_and_log_err(cx);
// },
// );
// cx.add_action(
// |workspace: &mut Workspace, _: &SaveAs, cx: &mut ViewContext<Workspace>| {
// workspace
// .save_active_item(SaveIntent::SaveAs, cx)
// .detach_and_log_err(cx);
// },
// );
// cx.add_action(|workspace: &mut Workspace, _: &ActivatePreviousPane, cx| {
// workspace.activate_previous_pane(cx)
// });
// cx.add_action(|workspace: &mut Workspace, _: &ActivateNextPane, cx| {
// workspace.activate_next_pane(cx)
// });
// cx.add_action(
// |workspace: &mut Workspace, action: &ActivatePaneInDirection, cx| {
// workspace.activate_pane_in_direction(action.0, cx)
// },
// );
// cx.add_action(
// |workspace: &mut Workspace, action: &SwapPaneInDirection, cx| {
// workspace.swap_pane_in_direction(action.0, cx)
// },
// );
.on_action(|this, e: &ToggleLeftDock, cx| {
println!("TOGGLING DOCK");
this.toggle_dock(DockPosition::Left, cx);
})
// cx.add_action(|workspace: &mut Workspace, _: &ToggleRightDock, cx| {
// workspace.toggle_dock(DockPosition::Right, cx);
// });
// cx.add_action(|workspace: &mut Workspace, _: &ToggleBottomDock, cx| {
// workspace.toggle_dock(DockPosition::Bottom, cx);
// });
// cx.add_action(|workspace: &mut Workspace, _: &CloseAllDocks, cx| {
// workspace.close_all_docks(cx);
// });
// cx.add_action(Workspace::activate_pane_at_index);
// cx.add_action(|workspace: &mut Workspace, _: &ReopenClosedItem, cx| {
// workspace.reopen_closed_item(cx).detach();
// });
// cx.add_action(|workspace: &mut Workspace, _: &GoBack, cx| {
// workspace
// .go_back(workspace.active_pane().downgrade(), cx)
// .detach();
// });
// cx.add_action(|workspace: &mut Workspace, _: &GoForward, cx| {
// workspace
// .go_forward(workspace.active_pane().downgrade(), cx)
// .detach();
// });
// cx.add_action(|_: &mut Workspace, _: &install_cli::Install, cx| {
// cx.spawn(|workspace, mut cx| async move {
// let err = install_cli::install_cli(&cx)
// .await
// .context("Failed to create CLI symlink");
// workspace.update(&mut cx, |workspace, cx| {
// if matches!(err, Err(_)) {
// err.notify_err(workspace, cx);
// } else {
// workspace.show_notification(1, cx, |cx| {
// cx.build_view(|_| {
// MessageNotification::new("Successfully installed the `zed` binary")
// })
// });
// }
// })
// })
// .detach();
// });
}
// todo!()
// #[cfg(any(test, feature = "test-support"))]
// pub fn test_new(project: ModelHandle<Project>, cx: &mut ViewContext<Self>) -> Self {
// use node_runtime::FakeNodeRuntime;
#[cfg(any(test, feature = "test-support"))] #[cfg(any(test, feature = "test-support"))]
pub fn test_new(project: Model<Project>, cx: &mut ViewContext<Self>) -> Self { pub fn test_new(project: Model<Project>, cx: &mut ViewContext<Self>) -> Self {
use gpui::Context; use gpui::Context;
@ -3791,28 +3704,19 @@ impl Render for Workspace {
.border_b() .border_b()
.border_color(cx.theme().colors().border) .border_color(cx.theme().colors().border)
.child(self.modal_layer.clone()) .child(self.modal_layer.clone())
// .children(
// Some(
// Panel::new("project-panel-outer", cx)
// .side(PanelSide::Left)
// .child(ProjectPanel::new("project-panel-inner")),
// )
// .filter(|_| self.is_project_panel_open()),
// )
// .children(
// Some(
// Panel::new("collab-panel-outer", cx)
// .child(CollabPanel::new("collab-panel-inner"))
// .side(PanelSide::Left),
// )
// .filter(|_| self.is_collab_panel_open()),
// )
// .child(NotificationToast::new(
// "maxbrunsfeld has requested to add you as a contact.".into(),
// ))
.child( .child(
div().flex().flex_col().flex_1().h_full().child( div()
div().flex().flex_1().child(self.center.render( .flex()
.flex_row()
.flex_1()
.h_full()
.child(div().flex().flex_1().child(self.left_dock.clone()))
.child(
div()
.flex()
.flex_col()
.flex_1()
.child(self.center.render(
&self.project, &self.project,
&self.follower_states, &self.follower_states,
self.active_call(), self.active_call(),
@ -3820,54 +3724,11 @@ impl Render for Workspace {
self.zoomed.as_ref(), self.zoomed.as_ref(),
&self.app_state, &self.app_state,
cx, cx,
)), ))
), // .children( .child(div().flex().flex_1().child(self.bottom_dock.clone())),
// Some( )
// Panel::new("terminal-panel", cx) .child(div().flex().flex_1().child(self.right_dock.clone())),
// .child(Terminal::new()) ),
// .allowed_sides(PanelAllowedSides::BottomOnly)
// .side(PanelSide::Bottom),
// )
// .filter(|_| self.is_terminal_open()),
// ),
), // .children(
// Some(
// Panel::new("chat-panel-outer", cx)
// .side(PanelSide::Right)
// .child(ChatPanel::new("chat-panel-inner").messages(vec![
// ChatMessage::new(
// "osiewicz".to_string(),
// "is this thing on?".to_string(),
// DateTime::parse_from_rfc3339("2023-09-27T15:40:52.707Z")
// .unwrap()
// .naive_local(),
// ),
// ChatMessage::new(
// "maxdeviant".to_string(),
// "Reading you loud and clear!".to_string(),
// DateTime::parse_from_rfc3339("2023-09-28T15:40:52.707Z")
// .unwrap()
// .naive_local(),
// ),
// ])),
// )
// .filter(|_| self.is_chat_panel_open()),
// )
// .children(
// Some(
// Panel::new("notifications-panel-outer", cx)
// .side(PanelSide::Right)
// .child(NotificationsPanel::new("notifications-panel-inner")),
// )
// .filter(|_| self.is_notifications_panel_open()),
// )
// .children(
// Some(
// Panel::new("assistant-panel-outer", cx)
// .child(AssistantPanel::new("assistant-panel-inner")),
// )
// .filter(|_| self.is_assistant_panel_open()),
// ),
) )
.child(self.status_bar.clone()) .child(self.status_bar.clone())
// .when(self.debug.show_toast, |this| { // .when(self.debug.show_toast, |this| {

View File

@ -55,7 +55,7 @@ node_runtime = { path = "../node_runtime" }
# outline = { path = "../outline" } # outline = { path = "../outline" }
# plugin_runtime = { path = "../plugin_runtime",optional = true } # plugin_runtime = { path = "../plugin_runtime",optional = true }
project = { package = "project2", path = "../project2" } project = { package = "project2", path = "../project2" }
# project_panel = { path = "../project_panel" } project_panel = { package = "project_panel2", path = "../project_panel2" }
# project_symbols = { path = "../project_symbols" } # project_symbols = { path = "../project_symbols" }
# quick_action_bar = { path = "../quick_action_bar" } # quick_action_bar = { path = "../quick_action_bar" }
# recent_projects = { path = "../recent_projects" } # recent_projects = { path = "../recent_projects" }

View File

@ -189,7 +189,7 @@ fn main() {
// file_finder::init(cx); // file_finder::init(cx);
// outline::init(cx); // outline::init(cx);
// project_symbols::init(cx); // project_symbols::init(cx);
// project_panel::init(Assets, cx); project_panel::init(Assets, cx);
// channel::init(&client, user_store.clone(), cx); // channel::init(&client, user_store.clone(), cx);
// diagnostics::init(cx); // diagnostics::init(cx);
// search::init(cx); // search::init(cx);

View File

@ -15,9 +15,10 @@ pub use only_instance::*;
pub use open_listener::*; pub use open_listener::*;
use anyhow::Result; use anyhow::Result;
use project_panel::ProjectPanel;
use std::sync::Arc; use std::sync::Arc;
use uuid::Uuid; use uuid::Uuid;
use workspace::{AppState, Workspace}; use workspace::{dock::PanelHandle as _, AppState, Workspace};
pub fn build_window_options( pub fn build_window_options(
bounds: Option<WindowBounds>, bounds: Option<WindowBounds>,
@ -138,9 +139,9 @@ pub fn initialize_workspace(
// } // }
// false // false
// }); // });
// })?; })?;
// let project_panel = ProjectPanel::load(workspace_handle.clone(), cx.clone()); let project_panel = ProjectPanel::load(workspace_handle.clone(), cx.clone());
// let terminal_panel = TerminalPanel::load(workspace_handle.clone(), cx.clone()); // let terminal_panel = TerminalPanel::load(workspace_handle.clone(), cx.clone());
// let assistant_panel = AssistantPanel::load(workspace_handle.clone(), cx.clone()); // let assistant_panel = AssistantPanel::load(workspace_handle.clone(), cx.clone());
// let channels_panel = // let channels_panel =
@ -151,36 +152,25 @@ pub fn initialize_workspace(
// workspace_handle.clone(), // workspace_handle.clone(),
// cx.clone(), // cx.clone(),
// ); // );
// let ( let (
// project_panel, project_panel,
// terminal_panel, // terminal_panel,
// assistant_panel, // assistant_panel,
// channels_panel, // channels_panel,
// chat_panel, // chat_panel,
// notification_panel, // notification_panel,
// ) = futures::try_join!( ) = futures::try_join!(
// project_panel, project_panel,
// terminal_panel, // terminal_panel,
// assistant_panel, // assistant_panel,
// channels_panel, // channels_panel,
// chat_panel, // chat_panel,
// notification_panel, // notification_panel,
// )?; )?;
// workspace_handle.update(&mut cx, |workspace, cx| {
// let project_panel_position = project_panel.position(cx); workspace_handle.update(&mut cx, |workspace, cx| {
// workspace.add_panel_with_extra_event_handler( let project_panel_position = project_panel.position(cx);
// project_panel, workspace.add_panel(project_panel, cx);
// cx,
// |workspace, _, event, cx| match event {
// project_panel::Event::NewSearchInDirectory { dir_entry } => {
// search::ProjectSearchView::new_search_in_directory(workspace, dir_entry, cx)
// }
// project_panel::Event::ActivatePanel => {
// workspace.focus_panel::<ProjectPanel>(cx);
// }
// _ => {}
// },
// );
// workspace.add_panel(terminal_panel, cx); // workspace.add_panel(terminal_panel, cx);
// workspace.add_panel(assistant_panel, cx); // workspace.add_panel(assistant_panel, cx);
// workspace.add_panel(channels_panel, cx); // workspace.add_panel(channels_panel, cx);
@ -198,7 +188,7 @@ pub fn initialize_workspace(
// .map_or(false, |entry| entry.is_dir()) // .map_or(false, |entry| entry.is_dir())
// }) // })
// { // {
// workspace.toggle_dock(project_panel_position, cx); workspace.toggle_dock(project_panel_position, cx);
// } // }
// cx.focus_self(); // cx.focus_self();
})?; })?;